Source code for openff.toolkit.topology.molecule

"""
Molecular chemical entity representation and routines to interface with cheminformatics toolkits

.. todo::

   * Our main philosophy here is to keep the object contents of topology objects easily serializable/deserializable

   * Have ``Molecule`` raise an exception if loading/creating molecules with unspecified stereochemistry?
   * Create ``FrozenMolecule`` to represent immutable molecule
   * Make ``Atom`` and ``Bond`` an inner class of Molecule?
   * Add ``Molecule.from_smarts()`` or ``.from_tagged_smiles()`` to allow a tagged SMARTS string
     (where tags are zero-indexed atom indices) to be used to create a molecule with the given atom numbering.
   * How can we make the ``Molecule`` API more useful to codes like perses that modify molecules on the fly?
   * Use `attrs <http://www.attrs.org/>`_ for convenient class initialization?
   * JSON/BSON representations of objects?
   * Generalize Molecule infrastructure to provide "plug-in" support for cheminformatics toolkits
   * Do we need a way to write a bunch of molecules to a file, or serialize a set of molecules to a file?
     We currently don't have a way to do that through the ``Molecule`` API, even though there is a way to
     read multiple molecules via ``Molecules.from_file()``.
   * Should we allow the removal of atoms too?
   * Should invalidation of cached properties be handled via something like a tracked list?
   * Refactor toolkit encapsulation to generalize and provide only a few major toolkit methods and toolkit objects
        that can be queried for features
   * Speed up overall import time by putting non-global imports only where they are needed

"""

import json
import operator
import pathlib
import warnings
from collections import UserDict
from copy import deepcopy
from functools import cmp_to_key
from typing import (
    IO,
    TYPE_CHECKING,
    Any,
    DefaultDict,
    Generator,
    Iterable,
    Literal,
    Optional,
    Sequence,
    TextIO,
    TypeVar,
    Union,
    overload,
)

import networkx as nx
import numpy as np
from openff.units.elements import MASSES, SYMBOLS
from openff.utilities.exceptions import MissingOptionalDependencyError
from typing_extensions import TypeAlias

from openff.toolkit import Quantity, unit
from openff.toolkit.utils.constants import DEFAULT_AROMATICITY_MODEL
from openff.toolkit.utils.exceptions import (
    AtomMappingWarning,
    BondExistsError,
    HierarchyIteratorNameConflictError,
    HierarchySchemeNotFoundException,
    HierarchySchemeWithIteratorNameAlreadyRegisteredException,
    IncompatibleShapeError,
    IncompatibleTypeError,
    IncompatibleUnitError,
    InvalidAtomMetadataError,
    InvalidBondOrderError,
    InvalidConformerError,
    InvalidQCInputError,
    MissingCMILESError,
    MissingConformersError,
    MissingPartialChargesError,
    MoleculeParseError,
    MultipleMoleculesInPDBError,
    RemapIndexError,
    SmilesParsingError,
    UnsupportedFileTypeError,
)
from openff.toolkit.utils.serialization import Serializable
from openff.toolkit.utils.toolkits import (
    GLOBAL_TOOLKIT_REGISTRY,
    InvalidToolkitRegistryError,
    OpenEyeToolkitWrapper,
    RDKitToolkitWrapper,
    ToolkitRegistry,
    ToolkitWrapper,
    UndefinedStereochemistryError,
)
from openff.toolkit.utils.utils import get_data_file_path, requires_package

if TYPE_CHECKING:
    import IPython.display
    import nglview
    from rdkit.Chem import Mol as RDMol

    from openff.toolkit.topology._mm_molecule import _SimpleAtom, _SimpleMolecule

# TODO: Can we have the `ALLOWED_*_MODELS` list automatically appear in the docstrings below?
# TODO: Should `ALLOWED_*_MODELS` be objects instead of strings?

# TODO: Allow all OpenEye aromaticity models to be used with OpenEye names?
#       Only support OEAroModel_MDL in RDKit version?

# TODO: These aliases are duplicated in a few places, might make sense to consolidate them
#       into a single location, but that'd weirdly nudge them towards first-class existence
TKR: TypeAlias = Union[ToolkitRegistry, ToolkitWrapper]
MoleculeLike: TypeAlias = Union["Molecule", "FrozenMolecule", "_SimpleMolecule"]
FM = TypeVar("FM", bound="FrozenMolecule")
P = TypeVar("P", bound="Particle")
A = TypeVar("A", bound="Atom")
B = TypeVar("B", bound="Bond")


class MoleculeDeprecationWarning(UserWarning):
    """Warning for deprecated portions of the Molecule API."""


[docs]class Particle(Serializable): """ Base class for all particles in a molecule. A particle object could be an ``Atom`` or similar. .. warning :: This API is experimental and subject to change. """ _molecule: "FrozenMolecule" @property def molecule(self) -> "FrozenMolecule": r""" The ``Molecule`` this particle is part of. .. todo:: * Should we have a single unique ``Molecule`` for each molecule type in the system, or if we have multiple copies of the same molecule, should we have multiple ``Molecule``\ s? """ return self._molecule @molecule.setter def molecule(self, molecule: "FrozenMolecule"): """ Set the particle's molecule pointer. Note that this will only work if the particle currently doesn't have a molecule """ assert ( self._molecule is None ), f"{type(self).__name__} already has an associated molecule" self._molecule = molecule @property def molecule_particle_index(self) -> int: """ Returns the index of this particle in its molecule """ return self._molecule.atoms.index(self) @property def name(self) -> str: """ The name of the particle """ return self._name @name.setter def name(self, name: str): """ Set the name of the particle """ self._name = name
[docs] def to_dict(self) -> dict: """Convert to dictionary representation.""" # Implement abstract method Serializable.to_dict() raise NotImplementedError() # TODO
[docs] @classmethod def from_dict(cls: type[P], d: dict) -> P: """Static constructor from dictionary representation.""" # Implement abstract method Serializable.to_dict() raise NotImplementedError() # TODO
class AtomMetadataDict(UserDict): def __init__(self, *args, **kwargs): self.data = {} self.update(dict(*args, **kwargs)) def __setitem__(self, key, value): if not isinstance(key, str): raise InvalidAtomMetadataError( f"Attempted to set atom metadata with a non-string key. (key: {key}" ) if not isinstance(value, (str, int)): raise InvalidAtomMetadataError( f"Attempted to set atom metadata with a non-string or integer " f"value. (value: {value})" ) super().__setitem__(key, value)
[docs]class Atom(Particle): """ A chemical atom. .. todo:: * Do we want to support the addition of arbitrary additional properties, such as floating point quantities (e.g. ``charge``), integral quantities (such as ``id`` or ``serial`` index in a PDB file), or string labels (such as Lennard-Jones types)? .. warning :: This API is experimental and subject to change. """
[docs] def __init__( self, atomic_number: int, formal_charge: Union[int, Quantity], is_aromatic: bool, name: Optional[str] = None, molecule=None, stereochemistry: Optional[str] = None, metadata: Optional[dict[str, Union[int, str]]] = None, ): """ Create an immutable Atom object. Object is serializable and immutable. Parameters ---------- atomic_number Atomic number of the atom. Must be non-negative and non-zero. formal_charge Formal charge of the atom is_aromatic If True, atom is aromatic; if False, not aromatic stereochemistry Either 'R' or 'S' for specified stereochemistry, or None for ambiguous stereochemistry name An optional name to be associated with the atom metadata An optional dictionary where keys are strings and values are strings or ints. This is intended to record atom-level information used to inform hierarchy definition and iteration, such as grouping atom by residue and chain. Examples -------- Create a non-aromatic carbon atom >>> atom = Atom(6, 0, False) Create a chiral carbon atom >>> atom = Atom(6, 0, False, stereochemistry='R', name='CT') """ if not isinstance(atomic_number, int): raise ValueError(f"atomic number must be int, found {type(atomic_number)}") if atomic_number <= 0: raise ValueError(f"atomic number must be positive, given {atomic_number}.") self._atomic_number = atomic_number # Use the setter here, since it will handle either ints or Quantities # and it is designed to quickly process ints self.formal_charge = formal_charge self._is_aromatic = is_aromatic self._stereochemistry = stereochemistry if name is None: name = "" self._name = name self._molecule = molecule # From Jeff: I'm going to assume that this is implicit in the parent Molecule's ordering of atoms # self._molecule_atom_index = molecule_atom_index self._bonds: list["Bond"] = list() if metadata is None: self._metadata = AtomMetadataDict() else: self._metadata = AtomMetadataDict(metadata)
# TODO: We can probably avoid an explicit call and determine this dynamically # from self._molecule (maybe caching the result) to get rid of some bookkeeping. # TODO: Should stereochemistry be reset/cleared/recomputed upon addition of a bond?
[docs] def add_bond(self, bond: "Bond"): """Adds a bond that this atom is involved in .. todo :: Is this how we want to keep records? Parameters ---------- bond A bond involving this atom """ self._bonds.append(bond)
[docs] def to_dict(self) -> dict[str, Union[None, str, int, bool, dict[Any, Any]]]: """Return a dict representation of the atom.""" # TODO: Should this be implicit in the atom ordering when saved? # atom_dict['molecule_atom_index'] = self._molecule_atom_index return { "atomic_number": self._atomic_number, "formal_charge": self._formal_charge.m, # Trust that the unit is e "is_aromatic": self._is_aromatic, "stereochemistry": self._stereochemistry, "name": self._name, "metadata": dict(self._metadata), }
[docs] @classmethod def from_dict(cls: type[A], atom_dict: dict) -> A: """Create an Atom from a dict representation.""" return cls(**atom_dict)
@property def metadata(self): """ The atom's metadata dictionary """ return self._metadata @property def formal_charge(self): """ The atom's formal charge """ return self._formal_charge @formal_charge.setter def formal_charge(self, other): """ Set the atom's formal charge. Accepts either ints or unit-wrapped ints with units of charge. """ if isinstance(other, int): self._formal_charge = Quantity(other, unit.elementary_charge) elif isinstance(other, Quantity): # Faster to check equality than convert, so short-circuit if other.units is unit.elementary_charge: self.formal_charge = other elif other.units in unit.elementary_charge.compatible_units(): self._formal_charge = other else: raise IncompatibleUnitError( f"Cannot set formal charge with a quantity with units {other.units}" ) elif hasattr(other, "unit"): from openmm import unit as openmm_unit if not isinstance(other, openmm_unit.Quantity): raise IncompatibleUnitError( "Unsupported type passed to formal_charge setter. " f"Found object of type {type(other)}." ) from openff.units.openmm import from_openmm converted = from_openmm(other) if converted.units in unit.elementary_charge.compatible_units(): self._formal_charge = converted else: raise IncompatibleUnitError( f"Cannot set formal charge with a quantity with units {converted.units}" ) else: raise ValueError @property def partial_charge(self): """ The partial charge of the atom, if any. Returns ------- unit-wrapped float with dimension of atomic charge, or None if no charge has been specified """ if self._molecule._partial_charges is None: return None else: index = self.molecule_atom_index return self._molecule._partial_charges[index] @partial_charge.setter def partial_charge(self, charge): if self.molecule.partial_charges is None: raise MissingPartialChargesError( "Cannot set individual atom's partial charge if it is in a molecule with no partial charges. " "Instead, use the `Molecule.partial_charges` setter. If this behavior is important to you, " "please raise an issue describing your use case." ) if not isinstance(charge, (Quantity, float)): raise ValueError( "Cannot set partial charge with an object that is not a openff.unit.Quantity or float. " f"Found object of type {type(charge)}." ) if isinstance(charge, float): charge = Quantity(charge, unit.elementary_charge) if not isinstance(charge.m, float): raise ValueError( "Cannot set partial charge with an object that is not a wrapped int or float. " f"Found unit-wrapped {type(charge.m)}." ) molecule_partial_charges = self.molecule.partial_charges molecule_partial_charges[self.molecule_atom_index] = charge self.molecule.partial_charges = molecule_partial_charges @property def is_aromatic(self): """ The atom's is_aromatic flag """ return self._is_aromatic @property def stereochemistry(self): """ The atom's stereochemistry (if defined, otherwise None) """ return self._stereochemistry @stereochemistry.setter def stereochemistry(self, value: Literal["CW", "CCW", None]): """Set the atoms stereochemistry Parameters ---------- value The stereochemistry around this atom, allowed values are "CW", "CCW", or None, """ # if (value != 'CW') and (value != 'CCW') and not(value is None): # raise Exception( # "Atom stereochemistry setter expected 'CW', 'CCW', or None. "" # "Received {} (type {})".format(value, type(value))" # ) self._stereochemistry = value @property def atomic_number(self) -> int: """ The integer atomic number of the atom. """ return self._atomic_number @property def symbol(self) -> str: """ Return the symbol implied by the atomic number of this atom """ return SYMBOLS[self.atomic_number] @property def mass(self) -> Quantity: """ The standard atomic weight (abundance-weighted isotopic mass) of the atomic site. The mass is reported in units of Dalton. """ # This is assumed elsewhere in the codebase to be in units of Dalton, which is what is # reported by MASSES as of openff-units v0.1.5. There may be performance implications if # other functions need to verify or convert units. # https://github.com/openforcefield/openff-toolkit/pull/1182#discussion_r802078273 return MASSES[self.atomic_number] @property def name(self): """ The name of this atom, if any """ return self._name @name.setter def name(self, other: str): """ Parameters ---------- other The new name for this atom """ if type(other) is not str: raise ValueError( f"In setting atom name. Expected str, received {other} (type {type(other)})." ) self._name = other @property def bonds(self): """ The list of ``Bond`` objects this atom is involved in. """ return self._bonds @property def bonded_atoms(self) -> Generator["Atom", None, None]: """ The list of ``Atom`` objects this atom is involved in bonds with """ for bond in self._bonds: for atom in bond.atoms: if atom is not self: # TODO: This seems dangerous. Ask John for a better way yield atom
[docs] def is_bonded_to(self, atom2): """ Determine whether this atom is bound to another atom Parameters ---------- atom2 a different atom in the same molecule Returns ------- bool Whether this atom is bound to atom2 """ # TODO: Sanity check (check for same molecule?) assert self != atom2 for bond in self._bonds: for bonded_atom in bond.atoms: if atom2 == bonded_atom: return True return False
[docs] def is_in_ring( self, toolkit_registry: ToolkitRegistry = GLOBAL_TOOLKIT_REGISTRY, ) -> bool: """ Return whether or not this atom is in a ring(s) (of any size) This Atom is expected to be attached to a molecule (`Atom.molecule`). Parameters ---------- toolkit_registry :class:`ToolkitRegistry` to use to enumerate the tautomers. """ _is_in_ring = toolkit_registry.call("atom_is_in_ring", self) return _is_in_ring
@property def molecule_atom_index(self) -> int: """ The index of this Atom within the the list of atoms in the parent ``Molecule``. """ if self._molecule is None: raise ValueError("This Atom does not belong to a Molecule object") if "_molecule_atom_index" in self.__dict__: return self._molecule_atom_index # type: ignore[has-type] self._molecule_atom_index = self._molecule.atoms.index(self) return self._molecule_atom_index def __repr__(self): # TODO: Also include which molecule this atom belongs to? return f"Atom(name={self._name}, atomic number={self._atomic_number})" def __str__(self): # TODO: Also include which molecule this atom belongs to? return "<Atom name='{}' atomic number='{}'>".format( self._name, self._atomic_number )
# ============================================================================================= # Bond Stereochemistry # ============================================================================================= # class BondStereochemistry(Serializable): # """ # Bond stereochemistry representation # """ # def __init__(self, stereo_type, neighbor1, neighbor2): # """ # # Parameters # ---------- # stereo_type # neighbor1 # neighbor2 # """ # assert isinstance(neighbor1, Atom) # assert isinstance(neighbor2, Atom) # # Use stereo_type @setter to check stereo type is a permitted value # self.stereo_type = stereo_type # self._neighbor1 = neighbor1 # self._neighbor2 = neighbor2 # def to_dict(self): # bs_dict = dict() # bs_dict['stereo_type'] = self._stereo_type # bs_dict['neighbor1_index'] = self._neighbor1.molecule_atom_index # bs_dict['neighbor2_index'] = self._neighbor2.molecule_atom_index # return bs_dict # classmethod # def from_dict(cls, molecule, bs_dict): # neighbor1 = molecule.atoms[bs_dict['neighbor1_index']] # neighbor2 = molecule.atoms[bs_dict['neighbor2_index']] # return cls.__init__(bs_dict['stereo_type'], neighbor1, neighbor2) # @property # def stereo_type(self): # return self._stereo_type # @stereo_type.setter # def stereo_type(self, value): # assert (value == 'CIS') or (value == 'TRANS') or (value is None) # self._stereo_type = value # @property # def neighbor1(self): # return self._neighbor1 # @property # def neighbor2(self): # return self._neighbor2 # @property # def neighbors(self): # return (self._neighbor1, self._neighbor2)
[docs]class Bond(Serializable): """ Chemical bond representation. .. warning :: This API is experimental and subject to change. .. todo :: Allow bonds to have associated properties. Attributes ---------- atom1, atom2 Atoms involved in the bond bond_order The (integer) bond order of this bond. is_aromatic Whether or not this bond is aromatic. fractional_bond_order The fractional bond order, or partial bond order of this bond. stereochemstry A string representing this stereochemistry of this bond. .. warning :: This API is experimental and subject to change. """
[docs] def __init__( self, atom1, atom2, bond_order, is_aromatic, fractional_bond_order=None, stereochemistry=None, ): """ Create a new chemical bond. """ assert type(atom1) is Atom assert type(atom2) is Atom assert atom1.molecule is atom2.molecule assert isinstance(atom1.molecule, FrozenMolecule) self._molecule = atom1.molecule self._atom1 = atom1 self._atom2 = atom2 atom1.add_bond(self) atom2.add_bond(self) # TODO: Check bondtype and fractional_bond_order are valid? # TODO: Dative bonds self._fractional_bond_order = fractional_bond_order self._bond_order = bond_order self._is_aromatic = is_aromatic self._stereochemistry = stereochemistry
[docs] def to_dict(self) -> dict[str, Union[int, bool, str, float]]: """ Return a dict representation of the bond. """ return { "atom1": self.atom1.molecule_atom_index, "atom2": self.atom2.molecule_atom_index, "bond_order": self._bond_order, "is_aromatic": self._is_aromatic, "stereochemistry": self._stereochemistry, "fractional_bond_order": self._fractional_bond_order, }
[docs] @classmethod def from_dict(cls: type[B], molecule: FM, d: dict) -> B: # type: ignore[override] """Create a Bond from a dict representation.""" # TODO: This is not used anywhere (`Molecule._initialize_bonds_from_dict()` just calls grabs # the two atoms and calls `Molecule._add_bond`). Remove or change that? # TODO: There is no point in feeding in a `molecule` argument since `Bond.__init__` already # requires (and checks) that the two atoms are part of the same molecule d["atom1"] = molecule.atoms[d["atom1"]] d["atom2"] = molecule.atoms[d["atom2"]] return cls( atom1=d["atom1"], atom2=d["atom2"], bond_order=d["bond_order"], is_aromatic=d["is_aromatic"], stereochemistry=d["stereochemistry"], fractional_bond_order=d["fractional_bond_order"], )
@property def atom1(self): return self._atom1 @property def atom2(self): return self._atom2 @property def atom1_index(self) -> int: return self.molecule.atoms.index(self._atom1) @property def atom2_index(self) -> int: return self.molecule.atoms.index(self._atom2) @property def atoms(self): return (self._atom1, self._atom2) @property def bond_order(self): return self._bond_order @bond_order.setter def bond_order(self, value): if isinstance(value, int): self._bond_order = value else: raise InvalidBondOrderError( "Only integer bond orders may be passed to `Bond.bond_order` setter. " "For aromatic bonds, instead kekulize the input structure and use " "the resulting integer bond orders. If performing partial bond " "order-based parameter interpolation, consider using " "`Bond.fractional_bond_order`." ) @property def fractional_bond_order(self): return self._fractional_bond_order @fractional_bond_order.setter def fractional_bond_order(self, value): self._fractional_bond_order = value @property def stereochemistry(self): return self._stereochemistry @property def is_aromatic(self) -> bool: return self._is_aromatic @property def molecule(self) -> "FrozenMolecule": return self._molecule @molecule.setter def molecule(self, value): """ Sets the Bond's parent molecule. Can not be changed after assignment """ # TODO: This is an impossible state (the constructor requires that atom1 and atom2 # are in a molecule, the same molecule, and sets that as self._molecule). # Should we remove this? assert ( self._molecule is None ), "Bond.molecule is already set and can only be set once" self._molecule = value @property def molecule_bond_index(self) -> int: """ The index of this Bond within the the list of bonds in ``Molecules``. """ if self._molecule is None: # TODO: This is unreachable; see `Bond.molecule` setter raise ValueError("This Atom does not belong to a Molecule object") return self._molecule.bonds.index(self)
[docs] def is_in_ring( self, toolkit_registry: ToolkitRegistry = GLOBAL_TOOLKIT_REGISTRY, ) -> bool: """ Return whether or not this bond is in a ring(s) (of any size) This Bond is expected to be attached to a molecule (`Bond.molecule`). Note: Bonds containing atoms that are only in separate rings, i.e. the central bond in a biphenyl, are not considered to be bonded by this criteria. Parameters ---------- toolkit_registry :class:`ToolkitRegistry` to use to enumerate the tautomers. Returns ------- is_in_ring Whether or not this bond is in a ring. """ _is_in_ring = toolkit_registry.call("bond_is_in_ring", self) return _is_in_ring
def __repr__(self): return f"Bond(atom1 index={self.atom1_index}, atom2 index={self.atom2_index})" def __str__(self): return ( f"<Bond atom1 index='{self.atom1_index}', atom2 index='{self.atom2_index}'>" )
# TODO: How do we automatically trigger invalidation of cached properties if an ``Atom`` or ``Bond`` is modified, # rather than added/deleted via the API? The simplest resolution is simply to make them immutable.
[docs]class FrozenMolecule(Serializable): """ Immutable chemical representation of a molecule, such as a small molecule or biopolymer. .. todo :: What other API calls would be useful for supporting biopolymers as small molecules? Perhaps iterating over chains and residues? Examples -------- Create a molecule from a sdf file >>> from openff.toolkit.utils import get_data_file_path >>> sdf_filepath = get_data_file_path('molecules/ethanol.sdf') >>> molecule = FrozenMolecule.from_file(sdf_filepath) Convert to OpenEye OEMol object >>> oemol = molecule.to_openeye() Create a molecule from an OpenEye molecule >>> molecule = FrozenMolecule.from_openeye(oemol) Convert to RDKit Mol object >>> rdmol = molecule.to_rdkit() Create a molecule from an RDKit molecule >>> molecule = FrozenMolecule.from_rdkit(rdmol) Create a molecule from IUPAC name (requires the OpenEye toolkit) >>> molecule = FrozenMolecule.from_iupac('imatinib') Create a molecule from SMILES >>> molecule = FrozenMolecule.from_smiles('Cc1ccccc1') .. warning :: This API is experimental and subject to change. """ _partial_charges: Optional[Quantity] _conformers: Optional[list[Quantity]] _properties: dict _hierarchy_schemes: dict
[docs] def __init__( self, other=None, file_format: Optional[str] = None, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, allow_undefined_stereo: bool = False, ): r""" Create a new FrozenMolecule object .. todo :: * If a filename or file-like object is specified but the file contains more than one molecule, what is the proper behavior? Read just the first molecule, or raise an exception if more than one molecule is found? * Should we also support SMILES strings or IUPAC names for ``other``\ ? Parameters ---------- other If specified, attempt to construct a copy of the molecule from the specified object. This can be any one of the following: * a :class:`Molecule` object * a file that can be used to construct a :class:`Molecule` object * an ``openeye.oechem.OEMol`` * an ``rdkit.Chem.rdchem.Mol`` * a serialized :class:`Molecule` object file_format If providing a file-like object, you must specify the format of the data. If providing a file, the file format will attempt to be guessed from the suffix. toolkit_registry A registry to use for I/O operations allow_undefined_stereo If loaded from a file and ``False``, raises an exception if undefined stereochemistry is detected during the molecule's construction. Examples -------- Create an empty molecule: >>> empty_molecule = FrozenMolecule() Create a molecule from a file that can be used to construct a molecule, using either a filename or file-like object: >>> from openff.toolkit.utils import get_data_file_path >>> sdf_filepath = get_data_file_path('molecules/ethanol.sdf') >>> molecule = FrozenMolecule(sdf_filepath) >>> molecule = FrozenMolecule(open(sdf_filepath, 'r'), file_format='sdf') >>> import gzip >>> mol2_gz_filepath = get_data_file_path('molecules/toluene.mol2.gz') >>> molecule = FrozenMolecule(gzip.GzipFile(mol2_gz_filepath, 'r'), file_format='mol2') Create a molecule from another molecule: >>> molecule_copy = FrozenMolecule(molecule) Convert to OpenEye OEMol object >>> oemol = molecule.to_openeye() Create a molecule from an OpenEye molecule: >>> molecule = FrozenMolecule(oemol) Convert to RDKit Mol object >>> rdmol = molecule.to_rdkit() Create a molecule from an RDKit molecule: >>> molecule = FrozenMolecule(rdmol) Convert the molecule into a dictionary and back again: >>> serialized_molecule = molecule.to_dict() >>> molecule_copy = FrozenMolecule(serialized_molecule) """ self._cached_smiles: dict[str, str] = dict() self._ordered_connection_table_hash: Optional[int] = None # Figure out if toolkit_registry is a whole registry, or just a single wrapper if isinstance(toolkit_registry, ToolkitRegistry): pass elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry toolkit_registry = ToolkitRegistry(toolkit_precedence=[]) toolkit_registry.add_toolkit(toolkit) else: raise InvalidToolkitRegistryError( "'toolkit_registry' must be either a ToolkitRegistry or a ToolkitWrapper" ) if other is None: self._initialize() else: loaded = False # Start a list of the ValueErrors the following logic encounters, so we can print it out # if there turned out to be no way to load this input value_errors = list() if isinstance(other, FrozenMolecule) and not loaded: self._copy_initializer(other) loaded = True if isinstance(other, Molecule) and not loaded: # TODO: This will need to be updated once FrozenMolecules and Molecules are significantly different self._copy_initializer(other) loaded = True if isinstance(other, dict) and not loaded: self._initialize_from_dict(other) loaded = True # Check through the toolkit registry to find a compatible wrapper for loading if not loaded: try: # Each ToolkitWrapper may provide a from_object method, which turns some particular type(s) # of object into OFFMols. For example, RDKitToolkitWrapper's from_object method will # return an OFFMol if provided with an RDMol, or raise a ValueError if it is provided # an OEMol (or anything else). This makes the assumption that any non-ValueError errors raised # by the toolkit _really are_ bad and should be raised immediately, which may be a bad assumption. result = toolkit_registry.call( "from_object", other, allow_undefined_stereo=allow_undefined_stereo, raise_exception_types=[UndefinedStereochemistryError], _cls=self.__class__, ) # NotImplementedError should never be raised... Only from_file and from_file_obj are provided # in the base ToolkitWrapper class and require overwriting, so from_object should be excluded # except NotImplementedError as e: # raise e # The toolkit registry will aggregate all errors except UndefinedStereochemistryErrors into a single # ValueError, which we should catch and and store that here. except ValueError as e: value_errors.append(e) else: self._copy_initializer(result) loaded = True # TODO: Make this compatible with file-like objects (I couldn't figure out how to make an oemolistream # from a fileIO object) if ( isinstance(other, (str, pathlib.Path)) or hasattr(other, "read") and not loaded ): try: mol = Molecule.from_file( other, file_format=file_format, toolkit_registry=toolkit_registry, allow_undefined_stereo=allow_undefined_stereo, ) # returns a list only if multiple molecules are found if type(mol) is list: raise ValueError( "Specified file or file-like object must contain exactly one molecule" ) except ValueError as e: value_errors.append(e) else: self._copy_initializer(mol) loaded = True # If none of the above methods worked, raise a ValueError summarizing the # errors from the different loading attempts if not loaded: msg = ( f"Cannot construct openff.toolkit.topology.Molecule from {other}\n" ) for value_error in value_errors: msg += str(value_error) raise ValueError(msg)
@property def has_unique_atom_names(self) -> bool: """``True`` if the molecule has unique atom names, ``False`` otherwise.""" return _has_unique_atom_names(self)
[docs] def generate_unique_atom_names(self): """ Generate unique atom names from the element symbol and count. Names are generated from the elemental symbol and the number of times that element is found in the molecule. The character 'x' is appended to these generated names to reduce the odds that they clash with an atom name or type imported from another source. For example, generated atom names might begin 'C1x', 'H1x', 'O1x', 'C2x', etc. """ return _generate_unique_atom_names(self)
def _validate(self): """ Validate the molecule, ensuring it has unique atom names """ if not self.has_unique_atom_names: self.generate_unique_atom_names()
[docs] def strip_atom_stereochemistry( self, smarts: str, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, ): """Delete stereochemistry information for certain atoms, if it is present. This method can be used to "normalize" molecules imported from different cheminformatics toolkits, which differ in which atom centers are considered stereogenic. Parameters ---------- smarts: str Tagged SMARTS with a single atom with index 1. Any matches for this atom will have any assigned stereocheistry information removed. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for I/O operations """ matches = self.chemical_environment_matches( smarts, toolkit_registry=toolkit_registry, ) for match in set(matches): atom_idx = match[0] self.atoms[atom_idx].stereochemistry = None
#################################################################################################### # Safe serialization ####################################################################################################
[docs] def to_dict(self) -> dict: """ Return a dictionary representation of the molecule. .. todo :: * Document the representation standard. * How do we do version control with this standard? Returns ------- molecule_dict A dictionary representation of the molecule. """ from openff.toolkit.utils.utils import serialize_numpy # typing.TypedDict might make this cleaner # https://mypy.readthedocs.io/en/latest/typed_dict.html#typeddict molecule_dict: dict[ str, Union[ None, str, bytes, dict[str, Any], list[str], list[bytes], list[HierarchyElement], ], ] = dict() molecule_dict["name"] = self._name molecule_dict["atoms"] = [atom.to_dict() for atom in self._atoms] molecule_dict["bonds"] = [bond.to_dict() for bond in self._bonds] # TODO: This assumes everything in _properties can safely be deepcopied molecule_dict["properties"] = deepcopy(self._properties) if hasattr(self, "_cached_properties"): molecule_dict["cached_properties"] = deepcopy(self._cached_properties) if self._conformers is None: molecule_dict["conformers"] = None else: molecule_dict["conformers_unit"] = "angstrom" molecule_dict["conformers"] = [ serialize_numpy(conf.m_as(unit.angstrom))[0] for conf in self._conformers ] if self._partial_charges is None: molecule_dict["partial_charges"] = None molecule_dict["partial_charge_unit"] = None else: molecule_dict["partial_charges"], _ = serialize_numpy( self._partial_charges.m_as(unit.elementary_charge) ) molecule_dict["partial_charge_unit"] = "elementary_charge" molecule_dict["hierarchy_schemes"] = dict() for iter_name, hier_scheme in self._hierarchy_schemes.items(): molecule_dict["hierarchy_schemes"][iter_name] = hier_scheme.to_dict() # type: ignore[index] return molecule_dict
def __hash__(self): """ Returns a hash of this molecule. Used when checking molecule uniqueness in Topology creation. Returns ------- string """ return hash(self.to_smiles())
[docs] def ordered_connection_table_hash(self) -> int: """Compute an ordered hash of the atoms and bonds in the molecule""" if self._ordered_connection_table_hash is not None: return self._ordered_connection_table_hash id = "" for atom in self.atoms: id += f"{atom.symbol}_{atom.formal_charge}_{atom.stereochemistry}__" for bond in self.bonds: id += f"{bond.bond_order}_{bond.stereochemistry}_{bond.atom1_index}_{bond.atom2_index}__" self._ordered_connection_table_hash = hash(id) return self._ordered_connection_table_hash
[docs] @classmethod def from_dict(cls: type[FM], molecule_dict: dict) -> FM: """ Create a new Molecule from a dictionary representation Parameters ---------- molecule_dict A dictionary representation of the molecule. Returns ------- molecule A Molecule created from the dictionary representation """ # This implementation is a compromise to let this remain as a classmethod mol = cls() mol._initialize_from_dict(molecule_dict) return mol
def _initialize_from_dict(self, molecule_dict: dict): """ Initialize the molecule from a dictionary representation Parameters ---------- molecule_dict A dictionary representation of the molecule. """ # TODO: Provide useful exception messages if there are any failures self._initialize() self.name = molecule_dict["name"] for atom_dict in molecule_dict["atoms"]: self._add_atom(**atom_dict, invalidate_cache=False) for bond_dict in molecule_dict["bonds"]: bond_dict["atom1"] = int(bond_dict["atom1"]) bond_dict["atom2"] = int(bond_dict["atom2"]) self._add_bond(**bond_dict, invalidate_cache=False) if molecule_dict["partial_charges"] is None: self._partial_charges = None else: from openff.toolkit.utils.utils import deserialize_numpy self._partial_charges = Quantity( deserialize_numpy(molecule_dict["partial_charges"], (self.n_atoms,)), unit.Unit(molecule_dict["partial_charge_unit"]), ) if molecule_dict["conformers"] is None: self._conformers: Optional[list[Quantity]] = None else: from openff.toolkit.utils.utils import deserialize_numpy self._conformers = [ Quantity( deserialize_numpy(ser_conf, (self.n_atoms, 3)), unit.Unit(molecule_dict["conformers_unit"]), ) for ser_conf in molecule_dict["conformers"] ] self._properties = deepcopy(molecule_dict["properties"]) for iter_name, hierarchy_scheme_dict in molecule_dict[ "hierarchy_schemes" ].items(): # It's important that we do NOT call `add_hierarchy_scheme` here, since we # need to deserialize these HierarchyElements exactly as they were serialized, # even if that conflicts with the current values in atom metadata. new_hier_scheme = HierarchyScheme( self, tuple(hierarchy_scheme_dict["uniqueness_criteria"]), iter_name, ) self._hierarchy_schemes[iter_name] = new_hier_scheme for element_dict in hierarchy_scheme_dict["hierarchy_elements"]: new_hier_scheme.add_hierarchy_element( tuple(element_dict["identifier"]), element_dict["atom_indices"] ) def __repr__(self): """Return a summary of this molecule; SMILES if valid, Hill formula if not.""" description = f"Molecule with name '{self.name}'" try: smiles = self.to_smiles() except Exception: hill = self.to_hill_formula() return description + f" with bad SMILES and Hill formula '{hill}'" return description + f" and SMILES '{smiles}'" def _initialize(self): """ Clear the contents of the current molecule. """ self._name = "" self._atoms = list() self._bonds = list() # list of bonds between Atom objects self._properties = {} # Attached properties to be preserved # self._cached_properties = None # Cached properties (such as partial charges) can be recomputed as needed self._partial_charges = None self._conformers = None # Optional conformers self._hill_formula = None # Cached Hill formula self._hierarchy_schemes = dict() self._ordered_connection_table_hash = None self._invalidate_cached_properties() def _copy_initializer(self, other): """ Copy contents of the specified molecule .. todo :: Should this be a ``@staticmethod`` where we have an explicit copy constructor? Parameters ---------- other Overwrite the state of this FrozenMolecule with the specified FrozenMolecule object. A deep copy is made. """ self._initialize_from_dict(other.to_dict()) def __eq__(self, other): """ Test two molecules for equality to see if they are the chemical species, but do not check other annotated properties. .. note :: Note that this method simply tests whether two molecules are identical chemical species using equivalence of their canonical isomeric SMILES. No effort is made to ensure that the atoms are in the same order or that any annotated properties are preserved. """ # updated to use the new isomorphic checking method, with full matching # TODO the doc string did not match the previous function what matching should this method do? return Molecule.are_isomorphic(self, other, return_atom_map=False)[0] def __deepcopy__(self, memo): cls = self.__class__ return cls(self.to_dict())
[docs] def add_default_hierarchy_schemes(self, overwrite_existing: bool = True): """ Adds ``chain`` and ``residue`` hierarchy schemes. The Open Force Field Toolkit has no native understanding of hierarchical atom organisation schemes common to other biomolecular software, such as "residues" or "chains" (see :ref:`userguide_hierarchy`). Hierarchy schemes allow iteration over groups of atoms according to their metadata. For more information, see :class:`~openff.toolkit.topology.molecule.HierarchyScheme`. If a ``Molecule`` with the default hierarchy schemes changes, :meth:`Molecule.update_hierarchy_schemes()` must be called before the residues or chains are iterated over again or else the iteration may be incorrect. Parameters ---------- overwrite_existing Whether to overwrite existing instances of the `residue` and `chain` hierarchy schemes. If this is ``False`` and either of the hierarchy schemes are already defined on this molecule, an exception will be raised. Raises ------ HierarchySchemeWithIteratorNameAlreadyRegisteredException When ``overwrite_existing=False`` and either the ``chains`` or ``residues`` hierarchy scheme is already configured. See also -------- HierarchyScheme, Molecule.add_hierarchy_scheme, Molecule.update_hierarchy_schemes, Molecule.perceive_residues, """ self._add_chain_hierarchy_scheme(overwrite_existing=overwrite_existing) self._add_residue_hierarchy_scheme(overwrite_existing=overwrite_existing)
def _add_chain_hierarchy_scheme(self, overwrite_existing: bool = True): """Add ``chain`` hierarchy scheme.""" if overwrite_existing: if "chains" in self._hierarchy_schemes.keys(): self.delete_hierarchy_scheme("chains") self.add_hierarchy_scheme(("chain_id",), "chains") def _add_residue_hierarchy_scheme(self, overwrite_existing: bool = True): """Add ``residue`` hierarchy scheme.""" if overwrite_existing: if "residues" in self._hierarchy_schemes.keys(): self.delete_hierarchy_scheme("residues") self.add_hierarchy_scheme( ("chain_id", "residue_number", "insertion_code", "residue_name"), "residues" )
[docs] def add_hierarchy_scheme( self, uniqueness_criteria: Iterable[str], iterator_name: str, ) -> "HierarchyScheme": """ Use the molecule's metadata to facilitate iteration over its atoms. This method will add an attribute with the name given by the ``iterator_name`` argument that provides an iterator over groups of atoms. Atoms are grouped by the values in their ``atom.metadata`` dictionary; any atoms with the same values for the keys given in the ``uniqueness_criteria`` argument will be in the same group. These groups have the type :class:`~openff.toolkit.topology.molecule.HierarchyElement`. Hierarchy schemes are not updated dynamically; if a ``Molecule`` with hierarchy schemes changes, :meth:`Molecule.update_hierarchy_schemes()` must be called before the scheme is iterated over again or else the grouping may be incorrect. Hierarchy schemes allow iteration over groups of atoms according to their metadata. For more information, see :class:`~openff.toolkit.topology.molecule.HierarchyScheme`. Parameters ---------- uniqueness_criteria The names of ``Atom`` metadata entries that define this scheme. An atom belongs to a ``HierarchyElement`` only if its metadata has the same values for these criteria as the other atoms in the ``HierarchyElement``. iterator_name Name of the iterator that will be exposed to access the hierarchy elements generated by this scheme. Must not match an existing attribute of the ``Molecule``, i.e. ``atoms``, ``angles``, etc. Returns ------- new_hier_scheme The newly created HierarchyScheme See also -------- Molecule.add_default_hierarchy_schemes, Molecule.hierarchy_schemes, Molecule.delete_hierarchy_scheme, Molecule.update_hierarchy_schemes, HierarchyScheme, """ if iterator_name in self._hierarchy_schemes: msg = ( f'Can not add iterator with name "{iterator_name}" to this molecule, as iterator ' f"name is already used by {self._hierarchy_schemes[iterator_name]}" ) raise HierarchySchemeWithIteratorNameAlreadyRegisteredException(msg) elif iterator_name in dir(self): raise HierarchyIteratorNameConflictError( f"Can not add iterator with name {iterator_name} to this molecule as an " "attribute with that name already exists." ) new_hier_scheme = HierarchyScheme( self, uniqueness_criteria, iterator_name, ) self._hierarchy_schemes[iterator_name] = new_hier_scheme self.update_hierarchy_schemes([iterator_name]) return new_hier_scheme
@property def hierarchy_schemes(self) -> dict[str, "HierarchyScheme"]: """ The hierarchy schemes available on the molecule. Hierarchy schemes allow iteration over groups of atoms according to their metadata. For more information, see :class:`~openff.toolkit.topology.molecule.HierarchyScheme`. Returns ------- A dict of the form {str: HierarchyScheme} The HierarchySchemes associated with the molecule. See also -------- Molecule.add_hierarchy_scheme, Molecule.delete_hierarchy_scheme, Molecule.update_hierarchy_schemes, Topology.hierarchy_iterator, HierarchyScheme """ return self._hierarchy_schemes
[docs] def delete_hierarchy_scheme(self, iter_name: str): """ Remove an existing ``HierarchyScheme`` specified by its iterator name. Hierarchy schemes allow iteration over groups of atoms according to their metadata. For more information, see :class:`~openff.toolkit.topology.molecule.HierarchyScheme`. Parameters ---------- iter_name See also -------- Molecule.add_hierarchy_scheme, Molecule.update_hierarchy_schemes, Molecule.hierarchy_schemes, HierarchyScheme """ if iter_name not in self._hierarchy_schemes: raise HierarchySchemeNotFoundException( f'Can not delete HierarchyScheme with name "{iter_name}" ' f"because no HierarchyScheme with that iterator name exists" ) self._hierarchy_schemes.pop(iter_name)
[docs] def update_hierarchy_schemes(self, iter_names: Optional[list[str]] = None): """ Infer a hierarchy from atom metadata according to the existing hierarchy schemes. Hierarchy schemes allow iteration over groups of atoms according to their metadata. For more information, see :class:`~openff.toolkit.topology.molecule.HierarchyScheme`. Parameters ---------- iter_names Only perceive hierarchy for HierarchySchemes that expose these iterator names. If not provided, all known hierarchies will be perceived, overwriting previous results if applicable. See also -------- Molecule.add_hierarchy_scheme, Molecule.delete_hierarchy_schemes, Molecule.hierarchy_schemes, HierarchyScheme """ if iter_names is None: iter_names = list(self._hierarchy_schemes.keys()) for iter_name in iter_names: hierarchy_scheme = self._hierarchy_schemes[iter_name] hierarchy_scheme.perceive_hierarchy()
def __getattr__(self, name: str) -> list["HierarchyElement"]: """If a requested attribute is not found, check the hierarchy schemes""" try: return self.__dict__["_hierarchy_schemes"][name].hierarchy_elements except KeyError: raise AttributeError( f"'{self.__class__.__name__}' object has no attribute {name!r}" ) def __dir__(self): """Add the hierarchy scheme iterator names to dir""" return list(self._hierarchy_schemes.keys()) + list(super().__dir__())
[docs] def to_smiles( self, isomeric: bool = True, explicit_hydrogens: bool = True, mapped: bool = False, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, ): """ Return a canonical isomeric SMILES representation of the current molecule. A partially mapped smiles can also be generated for atoms of interest by supplying an `atom_map` to the properties dictionary. .. note :: RDKit and OpenEye versions will not necessarily return the same representation. Parameters ---------- isomeric return an isomeric smiles explicit_hydrogens return a smiles string containing all hydrogens explicitly mapped return a explicit hydrogen mapped smiles, the atoms to be mapped can be controlled by supplying an atom map into the properties dictionary. If no mapping is passed all atoms will be mapped in order, else an atom map dictionary from the current atom index to the map id should be supplied with no duplicates. The map ids (values) should start from 0 or 1. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for SMILES conversion Returns ------- smiles Canonical isomeric explicit-hydrogen SMILES Examples -------- >>> from openff.toolkit.utils import get_data_file_path >>> sdf_filepath = get_data_file_path('molecules/ethanol.sdf') >>> molecule = Molecule(sdf_filepath) >>> smiles = molecule.to_smiles() """ # Figure out which toolkit should be used to create the SMILES if isinstance(toolkit_registry, ToolkitRegistry): to_smiles_method = toolkit_registry.resolve("to_smiles") elif isinstance(toolkit_registry, ToolkitWrapper): to_smiles_method = toolkit_registry.to_smiles # type: ignore[attr-defined] else: raise InvalidToolkitRegistryError( "Invalid toolkit_registry passed to to_smiles. Expected ToolkitRegistry or ToolkitWrapper. " f"Got {type(toolkit_registry)}" ) # Get a string representation of the function containing the toolkit name so we can check # if a SMILES was already cached for this molecule. This will return, for example # "RDKitToolkitWrapper.to_smiles" smiles_hash = ( to_smiles_method.__qualname__ + str(isomeric) + str(explicit_hydrogens) + str(mapped) ) smiles_hash += str(self._properties.get("atom_map", None)) # Check to see if a SMILES for this molecule was already cached using this method if smiles_hash in self._cached_smiles: return self._cached_smiles[smiles_hash] else: smiles = to_smiles_method(self, isomeric, explicit_hydrogens, mapped) self._cached_smiles[smiles_hash] = smiles return smiles
[docs] @classmethod def from_inchi( cls: type[FM], inchi: str, allow_undefined_stereo: bool = False, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, name: str = "", ) -> FM: """ Construct a Molecule from a InChI representation Parameters ---------- inchi The InChI representation of the molecule. allow_undefined_stereo Whether to accept InChI with undefined stereochemistry. If False, an exception will be raised if a InChI with undefined stereochemistry is passed into this function. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for InChI-to-molecule conversion name An optional name for the output molecule Returns ------- molecule Examples -------- Make cis-1,2-Dichloroethene: >>> molecule = Molecule.from_inchi('InChI=1S/C2H2Cl2/c3-1-2-4/h1-2H/b2-1-') """ if isinstance(toolkit_registry, ToolkitRegistry): molecule = toolkit_registry.call( "from_inchi", inchi, _cls=cls, allow_undefined_stereo=allow_undefined_stereo, name=name, ) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry molecule = toolkit.from_inchi( # type: ignore[attr-defined] inchi, _cls=cls, allow_undefined_stereo=allow_undefined_stereo, name=name, ) else: raise InvalidToolkitRegistryError( "Invalid toolkit_registry passed to from_inchi. Expected ToolkitRegistry or ToolkitWrapper. " f"Got {type(toolkit_registry)}" ) return molecule
[docs] def to_inchi( self, fixed_hydrogens: bool = False, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, ) -> str: """ Create an InChI string for the molecule using the requested toolkit backend. InChI is a standardised representation that does not capture tautomers unless specified using the fixed hydrogen layer. For information on InChi see here https://iupac.org/who-we-are/divisions/division-details/inchi/ Parameters ---------- fixed_hydrogens If a fixed hydrogen layer should be added to the InChI, if `True` this will produce a non standard specific InChI string of the molecule. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for molecule-to-InChI conversion Returns -------- inchi: str The InChI string of the molecule. Raises ------- InvalidToolkitRegistryError If an invalid object is passed as the toolkit_registry parameter """ if isinstance(toolkit_registry, ToolkitRegistry): inchi = toolkit_registry.call( "to_inchi", self, fixed_hydrogens=fixed_hydrogens ) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry inchi = toolkit.to_inchi(self, fixed_hydrogens=fixed_hydrogens) # type: ignore[attr-defined] else: raise InvalidToolkitRegistryError( "Invalid toolkit_registry passed to to_inchi. Expected ToolkitRegistry or ToolkitWrapper. " f"Got {type(toolkit_registry)}" ) return inchi
[docs] def to_inchikey( self, fixed_hydrogens: bool = False, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, ): """ Create an InChIKey for the molecule using the requested toolkit backend. InChIKey is a standardised representation that does not capture tautomers unless specified using the fixed hydrogen layer. For information on InChi see here https://iupac.org/who-we-are/divisions/division-details/inchi/ Parameters ---------- fixed_hydrogens If a fixed hydrogen layer should be added to the InChI, if `True` this will produce a non standard specific InChI string of the molecule. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for molecule-to-InChIKey conversion Returns -------- inchi_key: str The InChIKey representation of the molecule. Raises ------- InvalidToolkitRegistryError If an invalid object is passed as the toolkit_registry parameter """ if isinstance(toolkit_registry, ToolkitRegistry): inchi_key = toolkit_registry.call( "to_inchikey", self, fixed_hydrogens=fixed_hydrogens ) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry inchi_key = toolkit.to_inchikey(self, fixed_hydrogens=fixed_hydrogens) # type: ignore[attr-defined] else: raise InvalidToolkitRegistryError( "Invalid toolkit_registry passed to to_inchikey. Expected ToolkitRegistry or ToolkitWrapper. " f"Got {type(toolkit_registry)}" ) return inchi_key
[docs] @classmethod def from_smiles( cls: type[FM], smiles: str, hydrogens_are_explicit: bool = False, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, allow_undefined_stereo: bool = False, name: str = "", ) -> FM: """ Construct a ``Molecule`` from a SMILES representation The order of atoms in the ``Molecule`` is unspecified and may change from version to version or with different toolkits. SMILES atom indices (also known as atom maps) are not used to order atoms; instead, they are stored in the produced molecule's properties attribute, accessible via ``molecule.properties["atom_map"]``. The atom map is stored as a dictionary mapping molecule atom indices to SMILES atom maps. To order atoms according to SMILES atom indices, see :py:meth:`Molecule.from_mapped_smiles`, which helpfully raises an exception if any atom map is missing, duplicated, or out-of-range, or else :py:meth:`Molecule.remap` for arbitrary remaps. Parameters ---------- smiles The SMILES representation of the molecule. hydrogens_are_explicit If ``True``, forbid the cheminformatics toolkit from inferring hydrogen atoms not explicitly specified in the SMILES. toolkit_registry The cheminformatics toolkit to use to interpret the SMILES. allow_undefined_stereo Whether to accept SMILES with undefined stereochemistry. If ``False``, an exception will be raised if a SMILES with undefined stereochemistry is passed into this function. name An optional name for the output molecule Raises ------ RadicalsNotSupportedError If any atoms in the input molecule contain radical electrons. Examples -------- Create a ``Molecule`` representing toluene from SMILES: >>> molecule = Molecule.from_smiles('Cc1ccccc1') Create a ``Molecule`` representing phenol from SMILES with the oxygen at atom index 0 (SMILES indices begin at 1): >>> molecule = Molecule.from_smiles('c1ccccc1[OH:1]') >>> molecule = molecule.remap( ... {k: v - 1 for k, v in molecule.properties["atom_map"].items()}, ... partial=True, ... ) >>> assert molecule.atom(0).symbol == "O" See Also -------- from_mapped_smiles, remap """ if isinstance(toolkit_registry, ToolkitRegistry): molecule = toolkit_registry.call( "from_smiles", smiles, hydrogens_are_explicit=hydrogens_are_explicit, allow_undefined_stereo=allow_undefined_stereo, _cls=cls, name=name, ) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry molecule = toolkit.from_smiles( # type: ignore[attr-defined] smiles, hydrogens_are_explicit=hydrogens_are_explicit, allow_undefined_stereo=allow_undefined_stereo, _cls=cls, name=name, ) else: raise InvalidToolkitRegistryError( "Invalid toolkit_registry passed to from_smiles. Expected ToolkitRegistry or ToolkitWrapper. " f"Got {type(toolkit_registry)}" ) if "atom_map" in molecule._properties: if len(molecule._properties["atom_map"]) == molecule.n_atoms: warnings.warn( "Warning! Fully mapped SMILES pattern passed to `from_smiles`. The atom map is " "stored as a property in `Molecule._properties`, but these indices are NOT " "used to determine atom ordering. To use these indices for atom ordering, use " "`Molecule.from_mapped_smiles`.", AtomMappingWarning, stacklevel=2, ) return molecule
def _is_exactly_the_same_as(self, other): for atom1, atom2 in zip(self.atoms, other.atoms): if ( (atom1.atomic_number != atom2.atomic_number) or (atom1.formal_charge != atom2.formal_charge) or (atom1.is_aromatic != atom2.is_aromatic) or (atom1.stereochemistry != atom2.stereochemistry) ): return False for bond1, bond2 in zip(self.bonds, other.bonds): if ( (bond1.atom1_index != bond2.atom1_index) or (bond1.atom2_index != bond2.atom2_index) or (bond1.is_aromatic != bond2.is_aromatic) or (bond1.stereochemistry != bond2.stereochemistry) ): return False return True
[docs] @staticmethod def are_isomorphic( mol1: Union["FrozenMolecule", "_SimpleMolecule", nx.Graph], mol2: Union["FrozenMolecule", "_SimpleMolecule", nx.Graph], return_atom_map: bool = False, aromatic_matching: bool = True, formal_charge_matching: bool = True, bond_order_matching: bool = True, atom_stereochemistry_matching: bool = True, bond_stereochemistry_matching: bool = True, strip_pyrimidal_n_atom_stereo: bool = True, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, ) -> tuple[bool, Optional[dict[int, int]]]: """ Determine if ``mol1`` is isomorphic to ``mol2``. ``are_isomorphic()`` compares two molecule's graph representations and the chosen node/edge attributes. Connections and atomic numbers are always checked. If nx.Graphs() are given they must at least have ``atomic_number`` attributes on nodes. Other attributes that ``are_isomorphic()`` can optionally check... - ... in nodes are: - ``is_aromatic`` - ``formal_charge`` - ``stereochemistry`` - ... in edges are: - ``is_aromatic`` - ``bond_order`` - ``stereochemistry`` By default, all attributes are checked, but stereochemistry around pyrimidal nitrogen is ignored. .. warning :: This API is experimental and subject to change. Parameters ---------- mol1 The first molecule to test for isomorphism. mol2 The second molecule to test for isomorphism. return_atom_map Return a ``dict`` containing the atomic mapping, otherwise ``None``. Only processed if inputs are isomorphic, will always return ``None`` if inputs are not isomorphic. aromatic_matching If ``False``, aromaticity of graph nodes and edges are ignored for the purpose of determining isomorphism. formal_charge_matching If ``False``, formal charges of graph nodes are ignored for the purpose of determining isomorphism. bond_order_matching If ``False``, bond orders of graph edges are ignored for the purpose of determining isomorphism. atom_stereochemistry_matching If ``False``, atoms' stereochemistry is ignored for the purpose of determining isomorphism. bond_stereochemistry_matching If ``False``, bonds' stereochemistry is ignored for the purpose of determining isomorphism. strip_pyrimidal_n_atom_stereo If ``True``, any stereochemistry defined around pyrimidal nitrogen stereocenters will be disregarded in the isomorphism check. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for removing stereochemistry from pyrimidal nitrogens. Returns ------- molecules_are_isomorphic atom_map [dict[int,int]] ordered by mol1 indexing {mol1_index: mol2_index} If molecules are not isomorphic given input arguments, will return None instead of dict. """ import networkx as nx _cls = FrozenMolecule if isinstance(mol1, nx.Graph) and isinstance(mol2, nx.Graph): pass elif isinstance(mol1, nx.Graph): assert isinstance(mol2, _cls) elif isinstance(mol2, nx.Graph): assert isinstance(mol1, _cls) else: # static methods (by definition) know nothing about their class, # so the class to compare to must be hard-coded here if not (isinstance(mol1, _cls) and isinstance(mol2, _cls)): return False, None def _object_to_n_atoms(obj): if isinstance(obj, FrozenMolecule): return obj.n_atoms elif isinstance(obj, nx.Graph): return obj.number_of_nodes() else: raise TypeError( "are_isomorphic accepts a NetworkX Graph or OpenFF " + f"(Frozen)Molecule, not {type(obj)}" ) # Quick number of atoms check. Important for large molecules if _object_to_n_atoms(mol1) != _object_to_n_atoms(mol2): return False, None # If the number of atoms match, check the Hill formula if Molecule._object_to_hill_formula(mol1) != Molecule._object_to_hill_formula( mol2 ): return False, None # Do a quick check to see whether the inputs are totally identical (including being in the same atom order) if isinstance(mol1, FrozenMolecule) and isinstance(mol2, FrozenMolecule): if mol1._is_exactly_the_same_as(mol2): if return_atom_map: return True, {i: i for i in range(mol1.n_atoms)} else: return True, None # Build the user defined matching functions def node_match_func(x, y): # always match by atleast atomic number is_equal = x["atomic_number"] == y["atomic_number"] if aromatic_matching: is_equal &= x["is_aromatic"] == y["is_aromatic"] if formal_charge_matching: is_equal &= x["formal_charge"] == y["formal_charge"] if atom_stereochemistry_matching: is_equal &= x["stereochemistry"] == y["stereochemistry"] return is_equal # check if we want to do any bond matching if not the function is None if aromatic_matching or bond_order_matching or bond_stereochemistry_matching: def edge_match_func(x, y): # We don't need to check the exact bond order (which is 1 or 2) # if the bond is aromatic. This way we avoid missing a match only # if the alternate bond orders 1 and 2 are assigned differently. if aromatic_matching and bond_order_matching: is_equal = (x["is_aromatic"] == y["is_aromatic"]) or ( x["bond_order"] == y["bond_order"] ) elif aromatic_matching: is_equal = x["is_aromatic"] == y["is_aromatic"] elif bond_order_matching: is_equal = x["bond_order"] == y["bond_order"] else: is_equal = None if bond_stereochemistry_matching: if is_equal is None: is_equal = x["stereochemistry"] == y["stereochemistry"] else: is_equal &= x["stereochemistry"] == y["stereochemistry"] return is_equal else: edge_match_func = None # type: ignore # Here we should work out what data type we have, also deal with lists? def to_networkx(data: Union[FrozenMolecule, nx.Graph]) -> nx.Graph: """For the given data type, return the networkx graph""" if strip_pyrimidal_n_atom_stereo: SMARTS = "[N+0X3:1](-[*])(-[*])(-[*])" if isinstance(data, FrozenMolecule): # Molecule class instance if strip_pyrimidal_n_atom_stereo: # Make a copy of the molecule so we don't modify the original data = deepcopy(data) data.strip_atom_stereochemistry( SMARTS, toolkit_registry=toolkit_registry ) return data.to_networkx() elif isinstance(data, nx.Graph): return data else: raise NotImplementedError( f"The input type {type(data)} is not supported," f"please supply an openff.toolkit.topology.molecule.Molecule " f"or networkx.Graph representation of the molecule." ) mol1_netx = to_networkx(mol1) mol2_netx = to_networkx(mol2) from networkx.algorithms.isomorphism import GraphMatcher # type: ignore GM = GraphMatcher( mol1_netx, mol2_netx, node_match=node_match_func, edge_match=edge_match_func ) isomorphic = GM.is_isomorphic() if isomorphic and return_atom_map: topology_atom_map = GM.mapping # reorder the mapping by keys sorted_mapping = {} for key in sorted(topology_atom_map.keys()): sorted_mapping[key] = topology_atom_map[key] return isomorphic, sorted_mapping else: return isomorphic, None
[docs] def is_isomorphic_with( self, other: Union["FrozenMolecule", "_SimpleMolecule", nx.Graph], **kwargs, ) -> bool: """ Check if the molecule is isomorphic with the other molecule which can be an openff.toolkit.topology.Molecule or nx.Graph(). Full matching is done using the options described bellow. .. warning :: This API is experimental and subject to change. Parameters ---------- other aromatic_matching compare the aromatic attributes of bonds and atoms. formal_charge_matching compare the formal charges attributes of the atoms. bond_order_matching compare the bond order on attributes of the bonds. atom_stereochemistry_matching If ``False``, atoms' stereochemistry is ignored for the purpose of determining equality. bond_stereochemistry_matching If ``False``, bonds' stereochemistry is ignored for the purpose of determining equality. strip_pyrimidal_n_atom_stereo If ``True``, any stereochemistry defined around pyrimidal nitrogen stereocenters will be disregarded in the isomorphism check. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for removing stereochemistry from pyrimidal nitrogens. Returns ------- isomorphic """ return Molecule.are_isomorphic( self, other, return_atom_map=False, aromatic_matching=kwargs.get("aromatic_matching", True), formal_charge_matching=kwargs.get("formal_charge_matching", True), bond_order_matching=kwargs.get("bond_order_matching", True), atom_stereochemistry_matching=kwargs.get( "atom_stereochemistry_matching", True ), bond_stereochemistry_matching=kwargs.get( "bond_stereochemistry_matching", True ), strip_pyrimidal_n_atom_stereo=kwargs.get( "strip_pyrimidal_n_atom_stereo", True ), toolkit_registry=kwargs.get("toolkit_registry", GLOBAL_TOOLKIT_REGISTRY), )[0]
[docs] def generate_conformers( self, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, n_conformers: int = 10, rms_cutoff: Optional[Quantity] = None, clear_existing: bool = True, make_carboxylic_acids_cis: bool = True, ): """ Generate conformers for this molecule using an underlying toolkit. If ``n_conformers=0``, no toolkit wrapper will be called. If ``n_conformers=0`` and ``clear_existing=True``, ``molecule.conformers`` will be set to ``None``. Parameters ---------- toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for SMILES-to-molecule conversion n_conformers The maximum number of conformers to produce rms_cutoff The minimum RMS value at which two conformers are considered redundant and one is deleted. Precise implementation of this cutoff may be toolkit-dependent. If ``None``, the cutoff is set to be the default value for each ``ToolkitWrapper`` (generally 1 Angstrom). clear_existing Whether to overwrite existing conformers for the molecule make_carboxylic_acids_cis Guarantee all conformers have exclusively cis carboxylic acid groups (COOH) by rotating the proton in any trans carboxylic acids 180 degrees around the C-O bond. Works around a bug in conformer generation by the OpenEye toolkit where trans COOH is much more common than it should be. Examples -------- >>> molecule = Molecule.from_smiles('CCCCCC') >>> molecule.generate_conformers() Raises ------ InvalidToolkitRegistryError If an invalid object is passed as the toolkit_registry parameter """ # If no conformers are requested, do not call to a ToolkitWrapper at all if n_conformers == 0: if clear_existing: self._conformers = None return if isinstance(toolkit_registry, ToolkitRegistry): return toolkit_registry.call( "generate_conformers", self, n_conformers=n_conformers, rms_cutoff=rms_cutoff, clear_existing=clear_existing, raise_exception_types=[], make_carboxylic_acids_cis=make_carboxylic_acids_cis, ) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry return toolkit.generate_conformers( # type: ignore[attr-defined] self, n_conformers=n_conformers, rms_cutoff=rms_cutoff, clear_existing=clear_existing, make_carboxylic_acids_cis=make_carboxylic_acids_cis, ) else: raise InvalidToolkitRegistryError( "Invalid toolkit_registry passed to generate_conformers. Expected ToolkitRegistry or ToolkitWrapper. " f"Got {type(toolkit_registry)}" )
def _make_carboxylic_acids_cis( self, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY ): """ Rotate dihedral angle of any conformers with trans COOH groups so they are cis Carboxylic acid groups almost always exist in nature in the cis conformation, with the hydrogen atom in between the two oxygen atoms:: O----H / / / --C \\ \\ O However, the OpenEye toolkit frequently produces carboxylic acid geometries in the unrealistic trans conformation:: H----O / / / --C \\ \\ O This method converts all conformers in the molecule with the trans conformation into the corresponding cis conformer by rotating the OH bond around the CO bond by 180 degrees. Carboxylic acids that are already cis are unchanged. Carboxylic acid groups are considered cis if their O-C-O-H dihedral angle is acute. Parameters ---------- toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for SMILES-to-molecule conversion """ # Return early if there are no conformers if not self._conformers: return # Convert all conformers into one big array conformers = np.asarray([q.m_as(unit.angstrom) for q in self._conformers]) # Scan the molecule for carboxylic acids cooh_indices = self.chemical_environment_matches( "[C:2]([O:3][H:4])=[O:1]", toolkit_registry=toolkit_registry ) n_conformers, n_cooh_groups = len(conformers), len(cooh_indices) # Exit early if there are no carboxylic acids if not n_cooh_groups: return # Pull out the coordinates of all carboxylic acid groups into cooh_xyz cooh_xyz = conformers[:, cooh_indices, :] assert cooh_xyz.shape == (n_conformers, n_cooh_groups, 4, 3) def dot(a, b): """Compute dot product along last axis of arrays""" return np.sum(a * b, axis=-1)[..., np.newaxis] def norm(a): """Compute norm along last axis of array""" return np.linalg.norm(a, axis=-1)[..., np.newaxis] def dihedral(a): """Compute dihedrals of array with shape (..., 4, 3)""" # Praxeolitic formula # 1 sqrt, 1 cross product # from https://stackoverflow.com/q/20305272 p0 = a[..., 0, :] p1 = a[..., 1, :] p2 = a[..., 2, :] p3 = a[..., 3, :] b0 = -1.0 * (p1 - p0) b1 = p2 - p1 b2 = p3 - p2 # normalize b1 so that it does not influence magnitude of vector # rejections that come next b1 /= norm(b1) # vector rejections # v = projection of b0 onto plane perpendicular to b1 # = b0 minus component that aligns with b1 # w = projection of b2 onto plane perpendicular to b1 # = b2 minus component that aligns with b1 v = b0 - dot(b0, b1) * b1 w = b2 - dot(b2, b1) * b1 # angle between v and w in a plane is the torsion angle # v and w may not be normalized but that's fine since tan is y/x x = dot(v, w) y = dot(np.cross(b1, v), w) return np.arctan2(y, x) dihedrals = dihedral(cooh_xyz) assert dihedrals.shape == (n_conformers, n_cooh_groups, 1) dihedrals.shape = (n_conformers, n_cooh_groups, 1, 1) # Get indices of trans COOH groups trans_indices = np.logical_not( np.logical_and((-np.pi / 2) < dihedrals, dihedrals < (np.pi / 2)) ) # Expand array so it can be used to index cooh_xyz trans_indices = np.repeat(trans_indices, repeats=4, axis=2) trans_indices = np.repeat(trans_indices, repeats=3, axis=3) # Get indices of individual atoms in trans COOH groups (except terminal O) trans_indices_h = trans_indices.copy() trans_indices_h[:, :, (0, 1, 2), :] = False trans_indices_c = trans_indices.copy() trans_indices_c[:, :, (0, 2, 3), :] = False trans_indices_o = trans_indices.copy() trans_indices_o[:, :, (0, 1, 3), :] = False # Rotate OH around CO bond # We want to rotate H 180 degrees around the CO bond (b1) c = cooh_xyz[trans_indices_c].reshape(-1, 3) o = cooh_xyz[trans_indices_o].reshape(-1, 3) h = cooh_xyz[trans_indices_h].reshape(-1, 3) # Axis is defined as the line from the origin along a unit vector, so # move C to the origin and normalize point = h - c axis = o - c axis /= norm(axis) # Do the rotation # https://en.wikipedia.org/wiki/Rotation_matrix#Rotation_matrix_from_axis_and_angle rotated = axis * (dot(axis, point)) - np.cross(np.cross(axis, point), axis) # Move rotated point back to original coordinates rotated = rotated + c # Update the coordinates cooh_xyz[trans_indices_h] = rotated.reshape((-1)) # Update conformers with rotated coordinates conformers[:, cooh_indices, :] = cooh_xyz # Return conformers to original type self._conformers = [Quantity(conf, unit.angstrom) for conf in conformers]
[docs] def apply_elf_conformer_selection( self, percentage: float = 2.0, limit: int = 10, toolkit_registry: Optional[ Union[ToolkitRegistry, ToolkitWrapper] ] = GLOBAL_TOOLKIT_REGISTRY, **kwargs, ): """Select a set of diverse conformers from the molecule's conformers with ELF. Applies the `Electrostatically Least-interacting Functional groups method <https://docs.eyesopen.com/toolkits/python/quacpactk/molchargetheory.html#elf-conformer-selection>`_ to select a set of diverse conformers which have minimal electrostatically strongly interacting functional groups from the molecule's conformers. Parameters ---------- toolkit_registry The underlying toolkit to use to select the ELF conformers. percentage The percentage of conformers with the lowest electrostatic interaction energies to greedily select from. limit The maximum number of conformers to select. Notes ----- * The input molecule should have a large set of conformers already generated to select the ELF conformers from. * The selected conformers will be retained in the `conformers` list while unselected conformers will be discarded. See Also -------- openff.toolkit.utils.toolkits.OpenEyeToolkitWrapper.apply_elf_conformer_selection openff.toolkit.utils.toolkits.RDKitToolkitWrapper.apply_elf_conformer_selection """ if isinstance(toolkit_registry, ToolkitRegistry): toolkit_registry.call( "apply_elf_conformer_selection", molecule=self, percentage=percentage, limit=limit, **kwargs, ) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry toolkit.apply_elf_conformer_selection( # type: ignore[attr-defined] molecule=self, percentage=percentage, limit=limit, **kwargs ) else: raise InvalidToolkitRegistryError( f"Invalid toolkit_registry passed to apply_elf_conformer_selection." f"Expected ToolkitRegistry or ToolkitWrapper. Got " f"{type(toolkit_registry)}" )
[docs] def get_available_charge_methods( self, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, ) -> list[str]: """ Get the charge methods supported by each wrapper in the specified registry. Parameters ---------- toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for the calculation. """ if isinstance(toolkit_registry, ToolkitRegistry): return list( { method for wrapper in GLOBAL_TOOLKIT_REGISTRY.registered_toolkits for method in wrapper.supported_charge_methods } ) elif isinstance(toolkit_registry, ToolkitWrapper): return toolkit_registry.supported_charge_methods else: raise InvalidToolkitRegistryError( f"Invalid toolkit_registry passed to get_available_charge_methods" f"Expected ToolkitRegistry or ToolkitWrapper. Got {type(toolkit_registry)}" )
[docs] def assign_partial_charges( self, partial_charge_method: str, strict_n_conformers: bool = False, use_conformers: Optional[Iterable[Quantity]] = None, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, normalize_partial_charges: bool = True, ): """ Calculate partial atomic charges and store them in the molecule. ``assign_partial_charges`` computes charges using the specified toolkit and assigns the new values to the ``partial_charges`` attribute. Supported charge methods vary from toolkit to toolkit, but some supported methods are: - ``"am1bcc"`` - ``"am1bccelf10"`` (requires OpenEye Toolkits) - ``"am1-mulliken"`` - ``"mmff94"`` - ``"gasteiger"`` By default, the conformers on the input molecule are not used in the charge calculation. Instead, any conformers needed for the charge calculation are generated by this method. If this behavior is undesired, specific conformers can be provided via the ``use_conformers`` argument. ELF10 methods will neither fail nor warn when fewer than the expected number of conformers could be generated, as many small molecules are too rigid to provide a large number of conformers. Note that only the ``"am1bccelf10"`` partial charge method uses ELF conformer selection; the ``"am1bcc"`` method only uses a single conformer. This may confuse users as the `ToolkitAM1BCC`_ SMIRNOFF tag in a force field file defines that AM1BCC-ELF10 should be used if the OpenEye Toolkits are available. For more supported charge methods and their details, see the corresponding methods in each toolkit wrapper: - :meth:`OpenEyeToolkitWrapper.assign_partial_charges \ <openff.toolkit.utils.toolkits.OpenEyeToolkitWrapper.assign_partial_charges>` - :meth:`RDKitToolkitWrapper.assign_partial_charges \ <openff.toolkit.utils.toolkits.RDKitToolkitWrapper.assign_partial_charges>` - :meth:`AmberToolsToolkitWrapper.assign_partial_charges \ <openff.toolkit.utils.toolkits.AmberToolsToolkitWrapper.assign_partial_charges>` - :meth:`BuiltInToolkitWrapper.assign_partial_charges \ <openff.toolkit.utils.toolkits.BuiltInToolkitWrapper.assign_partial_charges>` .. _ToolkitAM1BCC: https://openforcefield.github.io/standards/standards/smirnoff/\ #toolkitam1bcc-temporary-support-for-toolkit-based-am1-bcc-partial-charges Parameters ---------- partial_charge_method The partial charge calculation method to use for partial charge calculation. strict_n_conformers Whether to raise an exception if an invalid number of conformers is provided for the given charge method. If this is False and an invalid number of conformers is found, a warning will be raised. use_conformers Coordinates to use for partial charge calculation. If ``None``, an appropriate number of conformers will be generated. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for the calculation. normalize_partial_charges Whether to offset partial charges so that they sum to the total formal charge of the molecule. This is used to prevent accumulation of rounding errors when the partial charge assignment method returns values at limited precision. Examples -------- Generate AM1 Mulliken partial charges. Conformers for the AM1 calculation are generated automatically: >>> molecule = Molecule.from_smiles('CCCCCC') >>> molecule.assign_partial_charges('am1-mulliken') To use pre-generated conformations, use the ``use_conformers`` argument: >>> molecule = Molecule.from_smiles('CCCCCC') >>> molecule.generate_conformers(n_conformers=1) >>> molecule.assign_partial_charges( ... 'am1-mulliken', ... use_conformers=molecule.conformers ... ) Raises ------ InvalidToolkitRegistryError If an invalid object is passed as the toolkit_registry parameter See Also -------- openff.toolkit.utils.toolkits.OpenEyeToolkitWrapper.assign_partial_charges openff.toolkit.utils.toolkits.RDKitToolkitWrapper.assign_partial_charges openff.toolkit.utils.toolkits.AmberToolsToolkitWrapper.assign_partial_charges openff.toolkit.utils.toolkits.BuiltInToolkitWrapper.assign_partial_charges """ # Raise a warning when users try to apply these charge methods to "large" molecules WARN_LARGE_MOLECULES: set[str] = { "am1bcc", "am1bccelf10", "am1-mulliken", "am1bccnosymspt", "am1elf10", } if partial_charge_method in WARN_LARGE_MOLECULES: if self.n_atoms > 150: warnings.warn( f"Warning! Partial charge method '{partial_charge_method}' is not designed " "for use on large (i.e. > 150 atoms) molecules and may crash or take hours to " f"run on this molecule (found {self.n_atoms} atoms). For more, see " "https://docs.openforcefield.org/projects/toolkit/en/stable/faq.html" "#parameterizing-my-system-which-contains-a-large-molecule-is-taking-forever-whats-wrong", stacklevel=2, ) if isinstance(toolkit_registry, ToolkitRegistry): # We may need to try several toolkitwrappers to find one # that supports the desired partial charge method, so we # tell the ToolkitRegistry to continue trying ToolkitWrappers # if one raises an error (raise_exception_types=[]) toolkit_registry.call( "assign_partial_charges", molecule=self, partial_charge_method=partial_charge_method, use_conformers=use_conformers, strict_n_conformers=strict_n_conformers, normalize_partial_charges=normalize_partial_charges, raise_exception_types=[], _cls=self.__class__, ) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit_wrapper: ToolkitWrapper = toolkit_registry toolkit_wrapper.assign_partial_charges( # type: ignore[attr-defined] self, partial_charge_method=partial_charge_method, use_conformers=use_conformers, strict_n_conformers=strict_n_conformers, normalize_partial_charges=normalize_partial_charges, _cls=self.__class__, ) else: raise InvalidToolkitRegistryError( f"Invalid toolkit_registry passed to assign_partial_charges." f"Expected ToolkitRegistry or ToolkitWrapper. Got {type(toolkit_registry)}" )
def _normalize_partial_charges(self): """ Add offsets to each partial charge to ensure that they sum to the formal charge of the molecule, to the limit of a python float's precision. Modifies the partial charges in-place. """ expected_charge = self.total_charge current_charge = 0.0 * unit.elementary_charge for pc in self.partial_charges: current_charge += pc charge_offset = (expected_charge - current_charge) / self.n_atoms self.partial_charges += charge_offset
[docs] def assign_fractional_bond_orders( self, bond_order_model: Optional[str] = None, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, use_conformers: Optional[Iterable[Quantity]] = None, ): """ Update and store list of bond orders this molecule. Bond orders are stored on each bond, in the ``bond.fractional_bond_order`` attribute. .. warning :: This API is experimental and subject to change. Parameters ---------- toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for SMILES-to-molecule conversion bond_order_model The bond order model to use for fractional bond order calculation. If ``None``, ``"am1-wiberg"`` is used. use_conformers The conformers to use for fractional bond order calculation. If ``None``, an appropriate number of conformers will be generated by an available ``ToolkitWrapper``. Examples -------- >>> from openff.toolkit import Molecule >>> molecule = Molecule.from_smiles('CCCCCC') >>> molecule.assign_fractional_bond_orders() Raises ------ InvalidToolkitRegistryError If an invalid object is passed as the toolkit_registry parameter """ if isinstance(toolkit_registry, ToolkitRegistry): return toolkit_registry.call( "assign_fractional_bond_orders", self, bond_order_model=bond_order_model, use_conformers=use_conformers, ) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry return toolkit.assign_fractional_bond_orders( # type: ignore[attr-defined] self, bond_order_model=bond_order_model, use_conformers=use_conformers ) else: raise InvalidToolkitRegistryError( f"Invalid toolkit_registry passed to assign_fractional_bond_orders. " f"Expected ToolkitRegistry or ToolkitWrapper. Got {type(toolkit_registry)}." )
def _invalidate_cached_properties(self): """ Indicate that the chemical entity has been altered. Note that this does not clear the `.properties` dictionary attribute. """ self._conformers = None self._partial_charges = None self._propers: set[tuple[Atom, Atom, Atom, Atom]] = set() self._impropers: set[tuple[Atom, Atom, Atom, Atom]] = set() self._hill_formula = None self._cached_smiles = dict() # TODO: Clear fractional bond orders self._ordered_connection_table_hash = None for atom in self.atoms: if "_molecule_atom_index" in atom.__dict__: del atom.__dict__["_molecule_atom_index"]
[docs] def to_networkx(self) -> nx.Graph: """Generate a NetworkX undirected graph from the molecule. Nodes are Atoms labeled with atom indices and atomic elements (via the ``element`` node atrribute). Edges denote chemical bonds between Atoms. .. todo :: * Do we need a ``from_networkx()`` method? If so, what would the Graph be required to provide? * Should edges be labeled with discrete bond types in some aromaticity model? * Should edges be labeled with fractional bond order if a method is specified? * Should we add other per-atom and per-bond properties (e.g. partial charges) if present? * Can this encode bond/atom chirality? Returns ------- graph The resulting graph, with nodes (atoms) labeled with atom indices, elements, stereochemistry and aromaticity flags and bonds with two atom indices, bond order, stereochemistry, and aromaticity flags Examples -------- Retrieve the bond graph for imatinib (OpenEye toolkit required) >>> molecule = Molecule.from_iupac('imatinib') >>> nxgraph = molecule.to_networkx() """ import networkx as nx G = nx.Graph() for atom in self.atoms: G.add_node( atom.molecule_atom_index, atomic_number=atom.atomic_number, is_aromatic=atom.is_aromatic, stereochemistry=atom.stereochemistry, formal_charge=atom.formal_charge, ) # G.add_node(atom.molecule_atom_index, attr_dict={'atomic_number': atom.atomic_number}) for bond in self.bonds: G.add_edge( bond.atom1_index, bond.atom2_index, bond_order=bond.bond_order, is_aromatic=bond.is_aromatic, stereochemistry=bond.stereochemistry, ) # G.add_edge(bond.atom1_index, bond.atom2_index, attr_dict={'order':bond.bond_order}) return G
[docs] def find_rotatable_bonds( self, ignore_functional_groups: Optional[list[str]] = None, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, ) -> list[Bond]: """ Find all bonds classed as rotatable ignoring any matched to the ``ignore_functional_groups`` list. Parameters ---------- ignore_functional_groups A list of bond SMARTS patterns to be ignored when finding rotatable bonds. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for SMARTS matching Returns ------- bonds: list[openff.toolkit.topology.molecule.Bond] The list of openff.toolkit.topology.molecule.Bond instances which are rotatable. """ # general rotatable bond smarts taken from RDKit # https://github.com/rdkit/rdkit/blob/1bf6ef3d65f5c7b06b56862b3fb9116a3839b229/rdkit/Chem/Lipinski.py#L47%3E rotatable_bond_smarts = "[!$(*#*)&!D1:1]-&!@[!$(*#*)&!D1:2]" # get all of the general matches general_matches = self.chemical_environment_matches( query=rotatable_bond_smarts, toolkit_registry=toolkit_registry ) # this will give all forwards and backwards matches, so condense them down with this function def condense_matches(matches): condensed_matches = set() for m in matches: condensed_matches.add(tuple(sorted(m))) return condensed_matches general_bonds = condense_matches(general_matches) # now refine the list using the ignore groups if ignore_functional_groups is not None: matches_to_ignore = set() # make ignore_functional_groups an iterable object if isinstance(ignore_functional_groups, str): ignore_functional_groups = [ignore_functional_groups] else: try: iter(ignore_functional_groups) except TypeError: raise ValueError( "Argument ignore_functional_groups must be iterable or str. " f"Found type {type(ignore_functional_groups)=}" ) # find the functional groups to remove for functional_group in ignore_functional_groups: # note I run the searches through this function so they have to be SMIRKS? ignore_matches = self.chemical_environment_matches( query=functional_group, toolkit_registry=toolkit_registry ) ignore_matches = condense_matches(ignore_matches) # add the new matches to the matches to ignore matches_to_ignore.update(ignore_matches) # now remove all the matches for match in matches_to_ignore: try: general_bonds.remove(match) # if the key is not in the list, the ignore pattern was not valid except KeyError: continue # gather a list of bond instances to return rotatable_bonds = [self.get_bond_between(*bond) for bond in general_bonds] return rotatable_bonds
def _add_atom( self, atomic_number: int, formal_charge: int, is_aromatic: bool, stereochemistry: Optional[str] = None, name: Optional[str] = None, metadata=None, invalidate_cache: bool = True, ) -> int: """ Add an atom Parameters ---------- atomic_number Atomic number of the atom formal_charge Formal charge of the atom is_aromatic If True, atom is aromatic; if False, not aromatic stereochemistry Either 'R' or 'S' for specified stereochemistry, or None if stereochemistry is irrelevant name An optional name for the atom metadata An optional dictionary where keys are strings and values are strings or ints. This is intended to record atom-level information used to inform hierarchy definition and iteration, such as grouping atom by residue and chain. invalidate_cache Whether or not to invalidate the cache of the molecule upon the addition of this atom. This should be left to its default value (`True`) for safety. Returns ------- index The index of the atom in the molecule Examples -------- Define a methane molecule >>> molecule = Molecule() >>> molecule.name = 'methane' >>> C = molecule.add_atom(6, 0, False) >>> H1 = molecule.add_atom(1, 0, False) >>> H2 = molecule.add_atom(1, 0, False) >>> H3 = molecule.add_atom(1, 0, False) >>> H4 = molecule.add_atom(1, 0, False) >>> bond_idx = molecule.add_bond(C, H1, False, 1) >>> bond_idx = molecule.add_bond(C, H2, False, 1) >>> bond_idx = molecule.add_bond(C, H3, False, 1) >>> bond_idx = molecule.add_bond(C, H4, False, 1) """ # Create an atom atom = Atom( atomic_number, formal_charge, is_aromatic, stereochemistry=stereochemistry, name=name, metadata=metadata, molecule=self, ) self._atoms.append(atom) if invalidate_cache: self._invalidate_cached_properties() # Since we just appended it, we can just return the length - 1 return len(self._atoms) - 1 def _add_bond( self, atom1, atom2, bond_order, is_aromatic, stereochemistry=None, fractional_bond_order=None, invalidate_cache: bool = True, ): """ Add a bond between two specified atom indices Parameters ---------- atom1 Index of first atom or first atom atom2_index Index of second atom or second atom bond_order Integral bond order of Kekulized form is_aromatic True if this bond is aromatic, False otherwise stereochemistry Either 'E' or 'Z' for specified stereochemistry, or None if stereochemistry is irrelevant fractional_bond_order The fractional (eg. Wiberg) bond order invalidate_cache Whether or not to invalidate the cache of the molecule upon the addition of this atom. This should be left to its default value (`True`) for safety. Returns ------- index The index of the bond in the molecule """ if isinstance(atom1, int) and isinstance(atom2, int): atom1_atom = self.atoms[atom1] atom2_atom = self.atoms[atom2] elif isinstance(atom1, Atom) and isinstance(atom2, Atom): atom1_atom = atom1 atom2_atom = atom2 else: raise ValueError( "Invalid inputs to molecule._add_bond. Expected ints or Atoms. " f"Received {atom1} (type {type(atom1)}) and {atom2} (type {type(atom2)}) " ) # TODO: Check to make sure bond does not already exist if atom1_atom.is_bonded_to(atom2_atom): raise BondExistsError( f"Bond already exists between {atom1_atom} and {atom2_atom})" ) bond = Bond( atom1_atom, atom2_atom, bond_order, is_aromatic, stereochemistry=stereochemistry, fractional_bond_order=fractional_bond_order, ) self._bonds.append(bond) if invalidate_cache: self._invalidate_cached_properties() # Since we just appended it, we can just return the length - 1 return len(self._bonds) - 1 def _add_conformer(self, coordinates: Quantity): """ Add a conformation of the molecule Parameters ---------- coordinates Coordinates of the new conformer, with the first dimension of the array corresponding to the atom index in the molecule's indexing system. Returns ------- index The index of this conformer """ if coordinates.shape != (self.n_atoms, 3): raise InvalidConformerError( "molecule.add_conformer given input of the wrong shape: " f"Given {coordinates.shape}, expected {(self.n_atoms, 3)}" ) if isinstance(coordinates, Quantity): if not coordinates.units.is_compatible_with(unit.angstrom): raise IncompatibleUnitError( "Coordinates passed to Molecule._add_conformer with incompatible units. " "Ensure that units are dimension of length." ) elif hasattr(coordinates, "unit"): from openff.units.openmm import from_openmm from openmm import unit as openmm_unit if not isinstance(coordinates, openmm_unit.Quantity): raise IncompatibleUnitError( "Unsupported type passed to Molecule._add_conformer setter. " "Found object of type {type(other)}." ) if not coordinates.unit.is_compatible(openmm_unit.meter): raise IncompatibleUnitError( "Coordinates passed to Molecule._add_conformer with units of incompatible dimensionality. " f"Adding conformers with OpenMM-style units is supported, by found units of {coordinates.unit}. " "Ensure that units are dimension of length." ) coordinates = from_openmm(coordinates) else: raise IncompatibleUnitError( "Unknown object passed to Molecule._add_conformer. Expected types include " f"openmm.unit.Quantity and openff.units.unit.Quantity, found type {type(coordinates)}." ) tmp_conf = Quantity( np.zeros(shape=(self.n_atoms, 3), dtype=float), unit.angstrom ) try: tmp_conf[:] = coordinates except AttributeError as e: # TODO: Make this a warning, log it, or do something other than print print(e) if self._conformers is None: # TODO should we checking that the exact same conformer is not in the list already? self._conformers = [] self._conformers.append(tmp_conf) return len(self._conformers) @property def partial_charges(self): """ Returns the partial charges (if present) on the molecule. Returns ------- partial_charges The partial charges on the molecule's atoms. Returns None if no charges have been specified. """ return self._partial_charges @partial_charges.setter def partial_charges(self, charges): """ Set the atomic partial charges for this molecule. Parameters ---------- charges The partial charges to assign to the molecule. If not None, must be in units compatible with openff.unit.elementary_charge """ if charges is None: self._partial_charges = None return if not hasattr(charges, "shape"): raise IncompatibleTypeError( "Unsupported type passed to partial_charges setter. " f"Found object of type {type(charges)}. " "Expected openff.units.unit.Quantity" ) if not charges.shape == (self.n_atoms,): raise IncompatibleShapeError( "Unsupported shape passed to partial_charges setter. " f"Found shape {charges.shape}, expected {(self.n_atoms,)}" ) if isinstance(charges, Quantity): if charges.units in unit.elementary_charge.compatible_units(): self._partial_charges = charges.astype(float) else: raise IncompatibleUnitError( "Unsupported unit passed to partial_charges setter. " f"Found unit {charges.units}, expected {unit.elementary_charge}" ) elif hasattr(charges, "unit"): from openmm import unit as openmm_unit if not isinstance(charges, openmm_unit.Quantity): raise IncompatibleUnitError( "Unsupported type passed to partial_charges setter. " f"Found object of type {type(charges)}." ) else: from openff.units.openmm import from_openmm converted = from_openmm(charges) if converted.units in unit.elementary_charge.compatible_units(): self._partial_charges = converted.astype(float) else: raise IncompatibleUnitError( "Unsupported unit passed to partial_charges setter. " f"Found unit {converted.units}, expected {unit.elementary_charge}" ) else: raise IncompatibleTypeError( "Unsupported type passed to partial_charges setter. " f"Found object of type {type(charges)}, " "expected openff.units.unit.Quantity" ) @property def n_atoms(self) -> int: """ The number of Atom objects. """ return len(self._atoms) @property def n_bonds(self) -> int: """ The number of Bond objects in the molecule. """ return len(self._bonds) @property def n_angles(self) -> int: """Number of angles in the molecule.""" self._construct_angles() return len(self._angles) @property def n_propers(self) -> int: """Number of proper torsions in the molecule.""" self._construct_torsions() return len(self._propers) @property def n_impropers(self) -> int: """Number of possible improper torsions in the molecule.""" self._construct_torsions() return len(self._impropers) @property def atoms(self): """ Iterate over all Atom objects in the molecule. """ return self._atoms
[docs] def atom(self, index: int) -> Atom: """ Get the atom with the specified index. Parameters ---------- index Returns ------- atom """ return self._atoms[index]
[docs] def atom_index(self, atom: Atom) -> int: """ Returns the index of the given atom in this molecule .. TODO: document behaviour when atom is not present in self Parameters ---------- atom Returns ------- index The index of the given atom in this molecule """ return atom.molecule_atom_index
@property def conformers(self): """ Returns the list of conformers for this molecule. Conformers are presented as a list of ``Quantity``-wrapped NumPy arrays, of shape (3 x n_atoms) and with dimensions of [Distance]. The return value is the actual list of conformers, and changes to the contents affect the original ``FrozenMolecule``. """ return self._conformers @property def n_conformers(self) -> int: """ The number of conformers for this molecule. """ if self._conformers is None: return 0 return len(self._conformers) @property def bonds(self) -> list[Bond]: """ Iterate over all Bond objects in the molecule. """ return self._bonds
[docs] def bond(self, index: int) -> Bond: """ Get the bond with the specified index. Parameters ---------- index Returns ------- bond """ return self._bonds[index]
@property def angles(self) -> set[tuple[Atom, Atom, Atom]]: """ Get an iterator over all i-j-k angles. """ self._construct_angles() return self._angles @property def torsions(self) -> set[tuple[Atom, Atom, Atom, Atom]]: """ Get an iterator over all i-j-k-l torsions. Note that i-j-k-i torsions (cycles) are excluded. Returns ------- torsions """ self._construct_torsions() assert ( self._torsions is not None ), "_construct_torsions always sets _torsions to a set" return self._torsions @property def propers(self) -> set[tuple[Atom, Atom, Atom, Atom]]: """ Iterate over all proper torsions in the molecule .. todo:: * Do we need to return a ``Torsion`` object that collects information about fractional bond orders? """ self._construct_torsions() assert ( self._propers is not None ), "_construct_torsions always sets _propers to a set" return self._propers @property def impropers(self) -> set[tuple[Atom, Atom, Atom, Atom]]: """ Iterate over all improper torsions in the molecule. .. todo :: * Do we need to return a ``Torsion`` object that collects information about fractional bond orders? Returns ------- impropers An iterator of tuples, each containing the atoms making up a possible improper torsion. See Also -------- smirnoff_impropers, amber_impropers """ self._construct_torsions() return self._impropers @property def smirnoff_impropers(self) -> set[tuple[Atom, Atom, Atom, Atom]]: """ Iterate over all impropers with trivalent centers, reporting the central atom second. The central atom is reported second in each torsion. This method reports an improper for each trivalent atom in the molecule, whether or not any given force field would assign it improper torsion parameters. Also note that this will return 6 possible atom orderings around each improper center. In current SMIRNOFF parameterization, three of these six orderings will be used for the actual assignment of the improper term and measurement of the angles. These three orderings capture the three unique angles that could be calculated around the improper center, therefore the sum of these three terms will always return a consistent energy. The exact three orderings that will be applied during parameterization can not be determined in this method, since it requires sorting the atom indices, and those indices may change when this molecule is added to a Topology. For more details on the use of three-fold ('trefoil') impropers, see https://openforcefield.github.io/standards/standards/smirnoff/#impropertorsions Returns ------- impropers An iterator of tuples, each containing the indices of atoms making up a possible improper torsion. The central atom is listed second in each tuple. See Also -------- impropers, amber_impropers """ return { improper for improper in self.impropers if len(self._bonded_atoms[improper[1]]) == 3 } @property def amber_impropers(self) -> set[tuple[Atom, Atom, Atom, Atom]]: """ Iterate over all impropers with trivalent centers, reporting the central atom first. The central atom is reported first in each torsion. This method reports an improper for each trivalent atom in the molecule, whether or not any given force field would assign it improper torsion parameters. Also note that this will return 6 possible atom orderings around each improper center. In current AMBER parameterization, one of these six orderings will be used for the actual assignment of the improper term and measurement of the angle. This method does not encode the logic to determine which of the six orderings AMBER would use. Returns ------- impropers An iterator of tuples, each containing the indices of atoms making up a possible improper torsion. The central atom is listed first in each tuple. See Also -------- impropers, smirnoff_impropers """ self._construct_torsions() return { (improper[1], improper[0], improper[2], improper[3]) for improper in self.smirnoff_impropers }
[docs] def nth_degree_neighbors(self, n_degrees): """ Return canonicalized pairs of atoms whose shortest separation is `exactly` n bonds. Only pairs with increasing atom indices are returned. Parameters ---------- n: int The number of bonds separating atoms in each pair Returns ------- neighbors tuples (len 2) of atom that are separated by ``n`` bonds. Notes ----- The criteria used here relies on minimum distances; when there are multiple valid paths between atoms, such as atoms in rings, the shortest path is considered. For example, two atoms in "meta" positions with respect to each other in a benzene are separated by two paths, one length 2 bonds and the other length 4 bonds. This function would consider them to be 2 apart and would not include them if ``n=4`` was passed. """ if n_degrees <= 0: raise ValueError( "Cannot consider neighbors separated by 0 or fewer atoms. Asked to consider " f"path lengths of {n_degrees}." ) else: return _nth_degree_neighbors_from_graphlike( graphlike=self, n_degrees=n_degrees )
@property def total_charge(self): """ Return the total charge on the molecule """ charge_sum = 0.0 * unit.elementary_charge for atom in self.atoms: charge_sum += atom.formal_charge return charge_sum @property def name(self) -> str: """ The name (or title) of the molecule """ return self._name @name.setter def name(self, other): """ Set the name of this molecule """ if other is None: self._name = "" elif type(other) is str: self._name = other else: raise ValueError("Molecule name must be a string") @property def properties(self) -> dict[str, Any]: """ The properties dictionary of the molecule """ return self._properties @property def hill_formula(self) -> str: """ Get the Hill formula of the molecule """ return self.to_hill_formula()
[docs] def to_hill_formula(self) -> str: """ Generate the Hill formula of this molecule. """ if self._hill_formula is None: atom_nums = [atom.atomic_number for atom in self.atoms] self._hill_formula = _atom_nums_to_hill_formula(atom_nums) return self._hill_formula
@staticmethod def _object_to_hill_formula(obj: Union["FrozenMolecule", nx.Graph]) -> str: """Take a Molecule or NetworkX graph and generate its Hill formula. This provides a backdoor to the old functionality of Molecule.to_hill_formula, which was a static method that duck-typed inputs of Molecule or graph objects.""" import networkx as nx if isinstance(obj, FrozenMolecule): return obj.to_hill_formula() elif isinstance(obj, nx.Graph): return _networkx_graph_to_hill_formula(obj) else: raise TypeError( "_object_to_hill_formula accepts a NetworkX Graph or OpenFF " + f"(Frozen)Molecule, not {type(obj)}" )
[docs] def chemical_environment_matches( self, query: str, unique: bool = False, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, ): """Find matches in the molecule for a SMARTS string Parameters ---------- query SMARTS string (with one or more tagged atoms). unique If ``True``, de-duplicates matches before returning. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for chemical environment matches Returns ------- matches A list of tuples, containing the indices of the matching atoms. Examples -------- Retrieve all the carbon-carbon bond matches in a molecule >>> molecule = Molecule.from_iupac('imatinib') >>> matches = molecule.chemical_environment_matches('[#6X3:1]~[#6X3:2]') .. todo :: * Do we want to generalize ``query`` to allow other kinds of queries, such as mdtraj DSL, pymol selections, atom index slices, etc? We could call it ``topology.matches(query)`` instead of ``chemical_environment_matches`` """ # Use specified cheminformatics toolkit to determine matches with specified aromaticity model # TODO: Simplify this by requiring a toolkit registry for the molecule? # TODO: Do we have to pass along an aromaticity model? if isinstance(toolkit_registry, ToolkitRegistry): matches = toolkit_registry.call( "find_smarts_matches", self, query, unique=unique, raise_exception_types=[], ) elif isinstance(toolkit_registry, ToolkitWrapper): matches = toolkit_registry.find_smarts_matches( # type: ignore[attr-defined] self, query, unique=unique, ) else: raise InvalidToolkitRegistryError( "'toolkit_registry' must be either a ToolkitRegistry or a ToolkitWrapper" ) return matches
[docs] @classmethod def from_iupac( cls: type[FM], iupac_name: str, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, allow_undefined_stereo: bool = False, **kwargs, ) -> FM: """Generate a molecule from IUPAC or common name .. note :: This method requires the OpenEye toolkit to be installed. Parameters ---------- iupac_name IUPAC name of molecule to be generated toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for chemical environment matches allow_undefined_stereo If false, raises an exception if molecule contains undefined stereochemistry. Returns ------- molecule The resulting molecule with position Examples -------- Create a molecule from an IUPAC name >>> molecule = Molecule.from_iupac('4-[(4-methylpiperazin-1-yl)methyl]-N-(4-methyl-3-{[4-(pyridin-3-yl)pyrimidin-2-yl]amino}phenyl)benzamide') # noqa Create a molecule from a common name >>> molecule = Molecule.from_iupac('imatinib') """ if isinstance(toolkit_registry, ToolkitRegistry): molecule = toolkit_registry.call( "from_iupac", iupac_name, allow_undefined_stereo=allow_undefined_stereo, _cls=cls, **kwargs, ) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry molecule = toolkit.from_iupac( # type: ignore[attr-defined] iupac_name, allow_undefined_stereo=allow_undefined_stereo, _cls=cls, **kwargs, ) else: raise InvalidToolkitRegistryError( "Invalid toolkit_registry passed to from_iupac. Expected ToolkitRegistry or ToolkitWrapper. " f"Got {type(toolkit_registry)}." ) return molecule
[docs] def to_iupac(self, toolkit_registry=GLOBAL_TOOLKIT_REGISTRY): """Generate IUPAC name from Molecule Returns ------- iupac_name IUPAC name of the molecule .. note :: This method requires the OpenEye toolkit to be installed. Examples -------- >>> from openff.toolkit.utils import get_data_file_path >>> sdf_filepath = get_data_file_path('molecules/ethanol.sdf') >>> molecule = Molecule(sdf_filepath) >>> iupac_name = molecule.to_iupac() """ if isinstance(toolkit_registry, ToolkitRegistry): to_iupac_method = toolkit_registry.resolve("to_iupac") elif isinstance(toolkit_registry, ToolkitWrapper): to_iupac_method = toolkit_registry.to_iupac # type: ignore[attr-defined] else: raise InvalidToolkitRegistryError( "Invalid toolkit_registry passed to to_iupac. Expected ToolkitRegistry or ToolkitWrapper. " f"Got {type(toolkit_registry)}" ) # TODO: Can `to_iupac` fail if given a well-behaved OFFMol/OEMol? result = to_iupac_method(self) return result
[docs] @classmethod def from_topology(cls: type[FM], topology) -> FM: """Return a Molecule representation of an OpenFF Topology containing a single Molecule object. Parameters ---------- topology The :class:`Topology` object containing a single :class:`Molecule` object. Note that OpenMM and MDTraj ``Topology`` objects are not supported. Returns ------- molecule The Molecule object in the topology Raises ------ ValueError If the topology does not contain exactly one molecule. Examples -------- Create a molecule from a Topology object that contains exactly one molecule >>> from openff.toolkit import Molecule, Topology >>> topology = Topology.from_molecules(Molecule.from_smiles('[CH4]')) >>> molecule = Molecule.from_topology(topology) """ # TODO: Ensure we are dealing with an OpenFF Topology object if topology.n_molecules != 1: raise ValueError("Topology must contain exactly one molecule") molecule = [i for i in topology.molecules][0] return cls(molecule)
[docs] def to_topology(self): """ Return an OpenFF Topology representation containing one copy of this molecule Returns ------- topology A Topology representation of this molecule Examples -------- >>> from openff.toolkit import Molecule >>> molecule = Molecule.from_iupac('imatinib') >>> topology = molecule.to_topology() """ from openff.toolkit.topology import Topology return Topology.from_molecules(self)
[docs] @classmethod def from_file( cls: type[FM], file_path: Union[str, pathlib.Path, TextIO], file_format=None, toolkit_registry=GLOBAL_TOOLKIT_REGISTRY, allow_undefined_stereo: bool = False, ) -> Union[FM, list[FM]]: """ Create one or more molecules from a file .. todo:: * Extend this to also include some form of .offmol Open Force Field Molecule format? * Generalize this to also include file-like objects? Parameters ---------- file_path The path to the file or file-like object to stream one or more molecules from. file_format Format specifier, usually file suffix (eg. 'MOL2', 'SMI') Note that not all toolkits support all formats. Check ToolkitWrapper.toolkit_file_read_formats for your loaded toolkits for details. toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for file loading. If a Toolkit is passed, only the highest-precedence toolkit is used allow_undefined_stereo If false, raises an exception if oemol contains undefined stereochemistry. Returns ------- molecules If there is a single molecule in the file, a Molecule is returned; otherwise, a list of Molecule objects is returned. Examples -------- >>> from openff.toolkit import Molecule >>> from openff.toolkit.utils.utils import get_data_file_path >>> sdf_file_path = get_data_file_path("molecules/toluene.sdf") >>> molecule = Molecule.from_file(sdf_file_path) """ toolkit: Optional[ToolkitWrapper] if file_format is None: if isinstance(file_path, pathlib.Path): file_path: str = file_path.as_posix() # type: ignore[no-redef] if not isinstance(file_path, str): raise ValueError( "If providing a file-like object for reading molecules, the format must be specified" ) # Assume that files ending in ".gz" should use their second-to-last suffix for compatibility check # TODO: Will all cheminformatics packages be OK with gzipped files? if file_path[-3:] == ".gz": file_format = file_path.split(".")[-2] else: file_format = file_path.split(".")[-1] file_format = file_format.upper() if file_format == "XYZ": raise UnsupportedFileTypeError( "Parsing `.xyz` files is not currently supported because they lack sufficient " "chemical information to be used with SMIRNOFF force fields. For more information, " "see https://open-forcefield-toolkit.readthedocs.io/en/latest/faq.html or to provide " "feedback please visit https://github.com/openforcefield/openff-toolkit/issues/1145." ) # Determine which toolkit to use (highest priority that's compatible with input type) if isinstance(toolkit_registry, ToolkitRegistry): # TODO: Encapsulate this logic into ToolkitRegistry.call()? toolkit = None supported_read_formats = {} for query_toolkit in toolkit_registry.registered_toolkits: if file_format in query_toolkit.toolkit_file_read_formats: toolkit = query_toolkit break supported_read_formats[query_toolkit.toolkit_name] = ( query_toolkit.toolkit_file_read_formats ) if toolkit is None: msg = ( f"No toolkits in registry can read file {file_path} (format {file_format}). Supported " f"formats in the provided ToolkitRegistry are {supported_read_formats}. " ) # Per issue #407, not allowing RDKit to read mol2 has confused a lot of people. Here we add text # to the error message that will hopefully reduce this confusion. if file_format == "MOL2" and RDKitToolkitWrapper.is_available(): msg += ( "RDKit does not fully support input of molecules from mol2 format unless they " "have Corina atom types, and this is not common in the simulation community. For this " "reason, the Open Force Field Toolkit does not use " "RDKit to read .mol2. Consider reading from SDF instead. If you would like to attempt " "to use RDKit to read mol2 anyway, you can load the molecule of interest into an RDKit " "molecule and use openff.toolkit.topology.Molecule.from_rdkit, but we do not recommend this." ) elif file_format == "PDB" and RDKitToolkitWrapper.is_available(): msg += ( "RDKit can not safely read PDBs on their own. Information about bond order and aromaticity " "is likely to be lost. PDBs can be used along with a valid smiles string with RDKit using " "the constructor Molecule.from_pdb_and_smiles(file_path, smiles)" ) raise NotImplementedError(msg) elif isinstance(toolkit_registry, ToolkitWrapper): # TODO: Encapsulate this logic in ToolkitWrapper? toolkit = toolkit_registry if file_format not in toolkit.toolkit_file_read_formats: msg = ( f"Toolkit {toolkit.toolkit_name} can not read file {file_path} (format {file_format}). Supported " f"formats for this toolkit are {toolkit.toolkit_file_read_formats}." ) if toolkit.toolkit_name == "The RDKit" and file_format == "PDB": msg += ( "RDKit can however read PDBs with a valid smiles string using the " "Molecule.from_pdb_and_smiles(file_path, smiles) constructor" ) raise NotImplementedError(msg) else: raise InvalidToolkitRegistryError( "'toolkit_registry' must be either a ToolkitRegistry or a ToolkitWrapper" ) mols = list() if isinstance(file_path, (str, pathlib.Path)): if isinstance(file_path, pathlib.Path): file_path = file_path.as_posix() mols = toolkit.from_file( # type: ignore[call-arg] file_path, file_format=file_format, allow_undefined_stereo=allow_undefined_stereo, _cls=cls, ) elif hasattr(file_path, "read"): file_obj = file_path mols = toolkit.from_file_obj( file_obj, file_format=file_format, allow_undefined_stereo=allow_undefined_stereo, _cls=cls, ) if len(mols) == 0: raise MoleculeParseError(f"Unable to read molecule from file: {file_path}") elif len(mols) == 1: return mols[0] return mols
[docs] @classmethod @requires_package("openmm") def from_polymer_pdb( cls: type[FM], file_path: Union[str, pathlib.Path, TextIO], toolkit_registry=GLOBAL_TOOLKIT_REGISTRY, name: str = "", ) -> FM: """ Loads a polymer from a PDB file. Also see :py:meth:`Topology.from_multicomponent_pdb`, which can do everything this method can and more. Currently only supports proteins with canonical amino acids that are either uncapped or capped by ACE/NME groups, but may later be extended to handle other common polymers, or accept user-defined polymer templates. Only one polymer chain may be present in the PDB file, and it must be the only molecule present. Connectivity and bond orders are assigned by matching SMARTS codes for the supported residues against atom names. The PDB file must include all atoms with the correct standard atom names described in the `PDB Chemical Component Dictionary <https://www.wwpdb.org/data/ccd>`_. Residue names are used to assist trouble-shooting failed assignments, but are not used in the actual assignment process. Metadata such as residues, chains, and atom names are recorded in the ``Atom.metadata`` attribute, which is a dictionary mapping from strings like "residue_name" to the appropriate value. ``from_polymer_pdb`` returns a molecule that can be iterated over with the ``.residues`` and ``.chains`` attributes, as well as the usual ``.atoms``. Parameters ---------- file_path PDB information to be passed to OpenMM PDBFile object for loading toolkit_registry = ToolkitWrapper or ToolkitRegistry. Default = None Either a ToolkitRegistry, ToolkitWrapper name An optional name for the output molecule Returns ------- molecule Raises ------ UnassignedChemistryInPDBError If an atom or bond could not be assigned; the exception will provide a detailed diagnostic of what went wrong. MultipleMoleculesInPDBError If all atoms and bonds could be assigned, but the PDB includes multiple chains or molecules. """ import io import openmm.unit as openmm_unit from openmm.app import PDBFile warnings.warn( "`Molecule.from_polymer_pdb` is deprecated in favor of `Topology.from_pdb`, the recommended " "method for loading PDB files. This method will be removed in a future release of the OpenFF Toolkit.", MoleculeDeprecationWarning, stacklevel=2, ) if isinstance(toolkit_registry, ToolkitWrapper): toolkit_registry = ToolkitRegistry([type(toolkit_registry)]) if isinstance(file_path, (str, io.TextIOWrapper)): pass elif isinstance(file_path, pathlib.Path): file_path = file_path.as_posix() else: raise ValueError(f"Unexpected type {type(file_path)}") pdb = PDBFile(file_path) # Kludgy fix for the fact that RDKitToolkitWrapper uses new substructure spec. # Hopefully this will be short-lived as we can deprecate this method entirely in favor of # Topology.from_pdb, which only uses the RDKit backend. resolved_method = toolkit_registry.resolve("_polymer_openmm_topology_to_offmol") if "RDKit" in str(resolved_method): substructure_file_path = get_data_file_path( "proteins/aa_residues_substructures_explicit_bond_orders_with_caps_explicit_connectivity.json" ) else: substructure_file_path = get_data_file_path( "proteins/aa_residues_substructures_explicit_bond_orders_with_caps.json" ) with open(substructure_file_path, "r") as subfile: substructure_dictionary = json.load(subfile) offmol = toolkit_registry.call( "_polymer_openmm_topology_to_offmol", cls, pdb.topology, substructure_dictionary, ) coords = Quantity( np.array( [ [*vec3.value_in_unit(openmm_unit.angstrom)] for vec3 in pdb.getPositions() ] ), unit.angstrom, ) offmol.add_conformer(coords) offmol = toolkit_registry.call("_assign_aromaticity_and_stereo_from_3d", offmol) for i, atom in enumerate(pdb.topology.atoms()): offmol.atoms[i].name = atom.name offmol.atoms[i].metadata["residue_name"] = atom.residue.name offmol.atoms[i].metadata["residue_number"] = atom.residue.id offmol.atoms[i].metadata["insertion_code"] = atom.residue.insertionCode offmol.atoms[i].metadata["chain_id"] = atom.residue.chain.id offmol.add_default_hierarchy_schemes() if offmol._has_multiple_molecules(): raise MultipleMoleculesInPDBError( "This PDB has multiple molecules. The OpenFF Toolkit requires " + "that only one molecule is present in a PDB. Try splitting " + "each molecule into its own PDB with another tool, and " + "load any small molecules with Molecule.from_pdb_and_smiles." ) offmol.name = name return offmol
def _has_multiple_molecules(self) -> bool: import networkx as nx graph = self.to_networkx() num_disconnected_subgraphs = sum(1 for _ in nx.connected_components(graph)) return num_disconnected_subgraphs > 1 def _to_xyz_file(self, file_path: Union[str, IO[str]]): """ Write the current molecule and its conformers to a multiframe xyz file, if the molecule has no current coordinates all atoms will be set to 0,0,0 in keeping with the behaviour of the backend toolkits. Information on the type of XYZ file written can be found here <http://openbabel.org/wiki/XYZ_(format)>. Parameters ---------- file_path A file-like object or the path to the file to be written. """ # If we do not have a conformer make one with all zeros if not self._conformers: conformers: list[Quantity] = [ Quantity(np.zeros((self.n_atoms, 3), dtype=float), unit.angstrom) ] else: conformers = self._conformers if len(conformers) == 1: end: Union[str, int] = "" title = ( lambda frame: f'{self.name if self.name != "" else self.hill_formula}{frame}\n' ) else: end = 1 title = ( lambda frame: f'{self.name if self.name != "" else self.hill_formula} Frame {frame}\n' ) # check if we have a file path or an open file object if isinstance(file_path, str): xyz_data: IO[str] = open(file_path, "w") else: xyz_data = file_path # add the data to the xyz_data list for i, geometry in enumerate(conformers, 1): xyz_data.write(f"{self.n_atoms}\n" + title(end)) for j, atom_coords in enumerate(geometry.m_as(unit.angstrom)): x, y, z = atom_coords xyz_data.write( f"{SYMBOLS[self.atoms[j].atomic_number]} {x: .10f} {y: .10f} {z: .10f}\n" ) # now we up the frame count end = i + 1 # now close the file xyz_data.close()
[docs] def to_file(self, file_path, file_format, toolkit_registry=GLOBAL_TOOLKIT_REGISTRY): """Write the current molecule to a file or file-like object Parameters ---------- file_path A file-like object or the path to the file to be written. file_format Format specifier, one of ['MOL2', 'MOL2H', 'SDF', 'PDB', 'SMI', 'CAN', 'TDT'] Note that not all toolkits support all formats toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for file writing. If a Toolkit is passed, only the highest-precedence toolkit is used Raises ------ ValueError If the requested file_format is not supported by one of the installed cheminformatics toolkits Examples -------- >>> molecule = Molecule.from_iupac('imatinib') >>> molecule.to_file('imatinib.mol2', file_format='mol2') # doctest: +SKIP >>> molecule.to_file('imatinib.sdf', file_format='sdf') # doctest: +SKIP >>> molecule.to_file('imatinib.pdb', file_format='pdb') # doctest: +SKIP """ toolkit: Optional[ToolkitRegistry] if isinstance(toolkit_registry, ToolkitRegistry): pass elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry # type: ignore[assignment] toolkit_registry = ToolkitRegistry(toolkit_precedence=[]) toolkit_registry.add_toolkit(toolkit) else: raise InvalidToolkitRegistryError( "'toolkit_registry' must be either a ToolkitRegistry or a ToolkitWrapper" ) file_format = file_format.upper() # check if xyz, use the toolkit independent method. if file_format == "XYZ": return self._to_xyz_file(file_path=file_path) # Take the first toolkit that can write the desired output format toolkit = None for query_toolkit in toolkit_registry.registered_toolkits: if file_format in query_toolkit.toolkit_file_write_formats: toolkit = query_toolkit break # Raise an exception if no toolkit was found to provide the requested file_format if toolkit is None: supported_formats = {} for _toolkit in toolkit_registry.registered_toolkits: supported_formats[_toolkit.toolkit_name] = ( _toolkit.toolkit_file_write_formats ) raise ValueError( f"The requested file format ({file_format}) is not available from any of the installed toolkits " f"(supported formats: {supported_formats})" ) if isinstance(file_path, (str, pathlib.Path)): toolkit.to_file(self, file_path, file_format) else: toolkit.to_file_obj(self, file_path, file_format) # type: ignore[attr-defined]
[docs] def enumerate_tautomers( self, max_states=20, toolkit_registry=GLOBAL_TOOLKIT_REGISTRY ): """ Enumerate the possible tautomers of the current molecule Parameters ---------- max_states The maximum amount of molecules that should be returned toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use to enumerate the tautomers. Returns ------- molecules A list of openff.toolkit.topology.Molecule instances not including the input molecule. """ if isinstance(toolkit_registry, ToolkitRegistry): molecules = toolkit_registry.call( "enumerate_tautomers", molecule=self, max_states=max_states ) elif isinstance(toolkit_registry, ToolkitWrapper): molecules = toolkit_registry.enumerate_tautomers( # type: ignore[attr-defined] self, max_states=max_states ) else: raise InvalidToolkitRegistryError( "'toolkit_registry' must be either a ToolkitRegistry or a ToolkitWrapper" ) return molecules
[docs] def enumerate_stereoisomers( self, undefined_only: bool = False, max_isomers: int = 20, rationalise: bool = True, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, ): """ Enumerate the stereocenters and bonds of the current molecule. Parameters ---------- undefined_only If we should enumerate all stereocenters and bonds or only those with undefined stereochemistry max_isomers The maximum amount of molecules that should be returned rationalise If we should try to build and rationalise the molecule to ensure it can exist toolkit_registry :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use to enumerate the stereoisomers. Returns -------- molecules A list of :class:`Molecule` instances not including the input molecule. """ if isinstance(toolkit_registry, ToolkitRegistry): molecules = toolkit_registry.call( "enumerate_stereoisomers", molecule=self, undefined_only=undefined_only, max_isomers=max_isomers, rationalise=rationalise, ) elif isinstance(toolkit_registry, ToolkitWrapper): molecules = toolkit_registry.enumerate_stereoisomers( # type: ignore[attr-defined] self, undefined_only=undefined_only, max_isomers=max_isomers, rationalise=rationalise, ) else: raise InvalidToolkitRegistryError( "'toolkit_registry' must be either a ToolkitRegistry or a ToolkitWrapper" ) return molecules
# TODO: This should probably be a classmethod
[docs] @OpenEyeToolkitWrapper.requires_toolkit() def enumerate_protomers(self, max_states: int = 0) -> list: """ Enumerate the formal charges of a molecule to generate different protomers. Parameters ---------- max_states The maximum number of protomer states to be returned. If 0, the default, attempt to return all protomers. If set to a non-zero number, the input molecule is not guaranteed to be included in the returned list. Returns ------- molecules A list of the protomers of the input molecules, including the input molecule if found by the underlying toolkit's protomer enumeration tool and not pruned by `max_states`. """ return OpenEyeToolkitWrapper().enumerate_protomers( molecule=self, max_states=max_states, )
[docs] @classmethod @RDKitToolkitWrapper.requires_toolkit() def from_rdkit( cls: type[FM], rdmol, allow_undefined_stereo: bool = False, hydrogens_are_explicit: bool = False, ) -> FM: """ Create a Molecule from an RDKit molecule. Requires the RDKit to be installed. Parameters ---------- rdmol An RDKit molecule allow_undefined_stereo If ``False``, raises an exception if ``rdmol`` contains undefined stereochemistry. hydrogens_are_explicit If ``False``, RDKit will perform hydrogen addition using ``Chem.AddHs`` Returns ------- molecule An OpenFF molecule Examples -------- Create a molecule from an RDKit molecule >>> from openff.toolkit import Molecule >>> from rdkit import Chem >>> rdmol = Chem.MolFromSmiles("CCO") >>> molecule = Molecule.from_rdkit(rdmol) """ toolkit = RDKitToolkitWrapper() molecule = toolkit.from_rdkit( rdmol, allow_undefined_stereo=allow_undefined_stereo, hydrogens_are_explicit=hydrogens_are_explicit, _cls=cls, ) return molecule
[docs] def to_rdkit( self, aromaticity_model=DEFAULT_AROMATICITY_MODEL, toolkit_registry=GLOBAL_TOOLKIT_REGISTRY, ) -> "RDMol": """ Create an RDKit molecule Requires the RDKit to be installed. Parameters ---------- aromaticity_model The aromaticity model to use. Only OEAroModel_MDL is supported. Returns ------- rdmol An RDKit molecule Examples -------- Convert a molecule to RDKit >>> from openff.toolkit.utils import get_data_file_path >>> sdf_filepath = get_data_file_path('molecules/ethanol.sdf') >>> molecule = Molecule(sdf_filepath) >>> rdmol = molecule.to_rdkit() """ # toolkit = RDKitToolkitWrapper() if isinstance(toolkit_registry, ToolkitWrapper): return toolkit_registry.to_rdkit(self, aromaticity_model=aromaticity_model) # type: ignore[attr-defined] else: return toolkit_registry.call( "to_rdkit", self, aromaticity_model=aromaticity_model )
[docs] @classmethod @OpenEyeToolkitWrapper.requires_toolkit() def from_openeye( cls: type[FM], oemol, allow_undefined_stereo: bool = False, ) -> "FrozenMolecule": """ Create a ``Molecule`` from an OpenEye molecule. Requires the OpenEye toolkit to be installed. Parameters ---------- oemol An OpenEye molecule allow_undefined_stereo If ``False``, raises an exception if oemol contains undefined stereochemistry. Returns ------- molecule An OpenFF molecule Examples -------- Create a ``Molecule`` from an OpenEye OEMol >>> from openff.toolkit import Molecule >>> from openeye import oechem >>> oemol = oechem.OEMol() >>> oechem.OESmilesToMol(oemol, '[H]C([H])([H])C([H])([H])O[H]') True >>> molecule = Molecule.from_openeye(oemol) """ toolkit = OpenEyeToolkitWrapper() molecule = toolkit.from_openeye( oemol, allow_undefined_stereo=allow_undefined_stereo, _cls=cls ) return molecule
[docs] @requires_package("qcelemental") def to_qcschema(self, multiplicity=1, conformer=0, extras=None): """ Create a QCElemental Molecule. The kekule structure of the molecule is saved in two places on the returned Molecule: * ``extras["canonical_isomeric_explicit_hydrogen_mapped_smiles"]`` * ``identifiers["canonical_isomeric_explicit_hydrogen_mapped_smiles"]`` .. warning :: This API is experimental and subject to change. Parameters ---------- multiplicity The multiplicity of the molecule; sets ``molecular_multiplicity`` field for QCElemental Molecule. conformer The index of the conformer to use for the QCElemental Molecule geometry. extras A dictionary that should be included in the ``extras`` field on the QCElemental Molecule. This can be used to include extra information, such as a smiles representation. Returns --------- qcelemental.models.Molecule A validated QCElemental Molecule. Examples -------- Create a QCElemental Molecule: >>> import qcelemental as qcel >>> mol = Molecule.from_smiles('CC') >>> mol.generate_conformers(n_conformers=1) >>> qcemol = mol.to_qcschema() Raises -------- MissingOptionalDependencyError If qcelemental is not installed, the qcschema can not be validated. InvalidConformerError No conformer found at the given index. """ import qcelemental as qcel # get/ check the geometry try: geometry = self.conformers[conformer].m_as(unit.bohr) except (IndexError, TypeError): raise InvalidConformerError( "The molecule must have a conformation to produce a valid qcschema; " f"no conformer was found at index {conformer}." ) # Gather the required qcschema data charge = self.total_charge.m_as(unit.elementary_charge) connectivity = [ (bond.atom1_index, bond.atom2_index, bond.bond_order) for bond in self.bonds ] symbols = [SYMBOLS[atom.atomic_number] for atom in self.atoms] if extras is not None: extras["canonical_isomeric_explicit_hydrogen_mapped_smiles"] = ( self.to_smiles(mapped=True) ) else: extras = { "canonical_isomeric_explicit_hydrogen_mapped_smiles": self.to_smiles( mapped=True ) } identifiers = { "canonical_isomeric_explicit_hydrogen_mapped_smiles": self.to_smiles( mapped=True ) } schema_dict = { "symbols": symbols, "geometry": geometry, # If we have no bonds we must supply None "connectivity": connectivity if connectivity else None, "molecular_charge": charge, "molecular_multiplicity": multiplicity, "extras": extras, "identifiers": identifiers, } return qcel.models.Molecule.from_data(schema_dict, validate=True)
[docs] @classmethod def from_mapped_smiles( cls: type[FM], mapped_smiles: str, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, allow_undefined_stereo: bool = False, ) -> FM: """ Create a ``Molecule`` from a SMILES string, ordering atoms from mappings SMILES strings support mapping integer indices to each atom by ending a bracketed atom declaration with a colon followed by a 1-indexed integer: .. code: "[H:3][C:1](=[O:2])[H:4]" This method creates a ``Molecule`` from such a SMILES string whose atoms are ordered according to the mapping. Each atom must be mapped exactly once; any duplicate, missing, or out-of-range mappings will cause the method to fail. .. warning :: This API is experimental and subject to change. Parameters ---------- mapped_smiles: str A mapped SMILES string with explicit hydrogens. toolkit_registry Cheminformatics toolkit to use for SMILES-to-molecule conversion allow_undefined_stereo If false, raise an exception if the SMILES contains undefined stereochemistry. Returns ---------- offmol An OpenFF molecule instance. Raises -------- SmilesParsingError If the given SMILES had no indexing picked up by the toolkits, or if the indexing is missing indices. RemapIndexError If the mapping has duplicate or out-of-range indices. Examples -------- Create a mapped chlorofluoroiodomethane molecule and check the atoms are placed accordingly: >>> molecule = Molecule.from_mapped_smiles( ... "[Cl:2][C@:1]([F:3])([I:4])[H:5]" ... ) >>> assert molecule.atom(0).symbol == "C" >>> assert molecule.atom(1).symbol == "Cl" >>> assert molecule.atom(2).symbol == "F" >>> assert molecule.atom(3).symbol == "I" >>> assert molecule.atom(4).symbol == "H" See Also -------- from_smiles, remap """ # create the molecule from the smiles and check we have the right number of indexes # in the mapped SMILES warnings.filterwarnings("ignore", category=AtomMappingWarning) offmol = cls.from_smiles( mapped_smiles, hydrogens_are_explicit=True, toolkit_registry=toolkit_registry, allow_undefined_stereo=allow_undefined_stereo, ) # https://stackoverflow.com/a/53763710 # this might be better: https://docs.python.org/3/library/warnings.html#warnings.catch_warnings warnings.filterwarnings("default", category=AtomMappingWarning) # check we found some mapping and remove it as we do not want to expose atom maps try: mapping = offmol._properties.pop("atom_map") except KeyError: raise SmilesParsingError( "The given SMILES has no indexing, please generate a valid explicit hydrogen " "mapped SMILES using cmiles." ) if len(mapping) != offmol.n_atoms: raise SmilesParsingError( "The mapped smiles does not contain enough indexes to remap the molecule." ) # remap the molecule using the atom map found in the smiles # the order is mapping = dict[current_index: new_index] # first renumber the mapping dict indexed from 0, currently from 1 as 0 indicates no mapping in toolkits adjusted_mapping = dict((current, new - 1) for current, new in mapping.items()) return offmol.remap(adjusted_mapping, current_to_new=True)
[docs] @classmethod @requires_package("qcelemental") def from_qcschema( cls: type[FM], qca_object, toolkit_registry=GLOBAL_TOOLKIT_REGISTRY, allow_undefined_stereo: bool = False, ): """ Create a Molecule from a QCArchive molecule record or dataset entry based on attached cmiles information. If this method is provided a QCElemental Molecule (or dict representation of a Molecule), it will return a single-conformer OpenFF Molecule. If this method is provided a QCFractal dataset Entry (or dict representation of an Entry), it will return an OpenFF Molecule with at least one conformer, corresponding to the: * ``.molecule`` attribute of a SinglepointDatasetEntry (single conformer) * ``.initial_molecule`` attribute of an OptimizationDatasetEntry or GridoptimizationDatasetEntry (single conformer) * ``initial_molecules`` attribute of a TorsiondriveDatasetEntry (one or more conformers, in the order that they appear when accessing the ``initial_molecules`` attribute on the Entry object) If these QC molecules have their ``.id`` fields populated, the returned OpenFF Molecule will have a dict mapping QC IDs to conformer numbers (``offmol.properties["initial_molecules"]``) The data source must also specify the kekule structure of the molecule. Currently the only supported format for this is in the ``canonical_isomeric_explicit_hydrogen_mapped_smiles`` field, which will be taken from the following locations, if available, in the following order of priority: * The input's ``attributes`` attribute (set on QCFractal DatasetEntry objects, such as ``SinglepointDatasetEntry`` and ``TorsiondriveDatasetEntry``) * The input's ``identifiers`` attribute (set on QCSchema Molecules made after QCFractal 0.50) * The input's ``extras`` attribute (the information was typically set on QCSchema Molecules as part of OpenFF's QC data submission pipeline before QCFractal 0.50) A QCElemental Molecule produced from ``Molecule.to_qcschema`` can be round-tripped through this method to produce a new, valid Molecule. Parameters ---------- qca_object A QCArchive molecule record or dataset entry, or dict representation of either. toolkit_registry openff.toolkit.utils.toolkits.ToolkitWrapper, optional :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for SMILES-to-molecule conversion allow_undefined_stereo If false, raises an exception if qca_object contains undefined stereochemistry. Returns ------- molecule An OpenFF molecule instance. Examples -------- Get Molecule from a QCArchive molecule record: >>> try: ... from qcportal import PortalClient ... except ImportError: ... import pytest ... pytest.skip("This tests sometimes fails when OpenEye is installed") >>> client = PortalClient("https://api.qcarchive.molssi.org:443/") >>> offmol = Molecule.from_qcschema( ... [*client.query_molecules(molecular_formula="C16H20N3O5")][-1] ... ) >>> offmol.to_hill_formula() 'C16H20N3O5' Get Molecule from a QCArchive optimization entry: >>> from qcportal import PortalClient >>> client = PortalClient("https://api.qcarchive.molssi.org:443/") >>> optimizations = client.get_dataset( ... dataset_type="optimization", ... dataset_name="SMIRNOFF Coverage Set 1", ... ) >>> offmol = Molecule.from_qcschema(optimizations.get_entry('coc(o)oc-0')) >>> offmol.to_hill_formula() 'C3H8O3' Raises ------- InvalidQCInputError If the input record isn't suitable to be made into an OpenFF Molecule MissingCMILESError If the record does not contain the ``canonical_isomeric_explicit_hydrogen_mapped_smiles``. InvalidConformerError If the conformer could not be attached. """ # Process input as dict; convert if necessary if not isinstance(qca_object, dict): try: qca_object = qca_object.dict() except AttributeError: raise AttributeError( f"The input object (type {type(qca_object)=} " "passed is not and a dict and could not be converted to a dict." ) if "symbols" in qca_object.keys(): mol_dicts = [qca_object] else: mol_dicts = [qca_object.get("molecule")] if not mol_dicts[0]: mol_dicts = [qca_object.get("initial_molecule")] if not mol_dicts[0]: # TorsionDriveEntries will have a list of mols instead of just one, # so we don't need to cast this to list mol_dicts = qca_object.get("initial_molecules") if not mol_dicts: raise InvalidQCInputError( f"Unable to find molecule information in qcschema input. {qca_object=}" ) first_cmiles = None for mol_dict in mol_dicts: # Entries sometimes have their cmiles here cmiles = qca_object.get("attributes", {}).get( "canonical_isomeric_explicit_hydrogen_mapped_smiles" ) if not cmiles: cmiles = mol_dict.get("identifiers", {}).get( "canonical_isomeric_explicit_hydrogen_mapped_smiles" ) if not cmiles: cmiles = mol_dict.get("extras", {}).get( "canonical_isomeric_explicit_hydrogen_mapped_smiles" ) if not cmiles: raise MissingCMILESError( f"Unable to find CMILES in qcschema input molecule. {mol_dict=}" ) if first_cmiles is None: first_cmiles = cmiles offmol = cls.from_mapped_smiles( cmiles, toolkit_registry=toolkit_registry, allow_undefined_stereo=allow_undefined_stereo, ) else: if first_cmiles != cmiles: raise InvalidQCInputError( f"Input entry has multiple molecule records with different CMILES. " f"{first_cmiles} != {cmiles} when iterating over molecules for " f"input {qca_object}" ) geometry = Quantity( np.array(mol_dict["geometry"], float).reshape(-1, 3), unit.bohr ) offmol._add_conformer(geometry.to(unit.angstrom)) # If there's a QCA ID for this QC molecule, store it in the OFF molecule with reference to # its corresponding conformer if "id" in mol_dict.keys(): mol_map = offmol.properties.get("initial_molecules", dict()) mol_map[offmol.n_conformers - 1] = mol_dict["id"] offmol.properties["initial_molecules"] = mol_map return offmol
[docs] @classmethod @RDKitToolkitWrapper.requires_toolkit() def from_pdb_and_smiles( cls: type[FM], file_path, smiles, allow_undefined_stereo: bool = False, name: str = "", ) -> FM: """ Create a Molecule from a pdb file and a SMILES string using RDKit. Requires RDKit to be installed. .. warning :: This API is experimental and subject to change. The molecule is created and sanitised based on the SMILES string, we then find a mapping between this molecule and one from the PDB based only on atomic number and connections. The SMILES molecule is then reindexed to match the PDB, the conformer is attached, and the molecule returned. Note that any stereochemistry in the molecule is set by the SMILES, and not the coordinates of the PDB. Parameters ---------- file_path PDB file path smiles a valid smiles string for the pdb, used for stereochemistry, formal charges, and bond order allow_undefined_stereo If false, raises an exception if SMILES contains undefined stereochemistry. name An optional name for the output molecule Returns -------- molecule An OFFMol instance with ordering the same as used in the PDB file. Raises ------ InvalidConformerError If the SMILES and PDB molecules are not isomorphic. """ warnings.warn( "`Molecule.from_pdb_and_smiles` is deprecated in favor of `Topology.from_pdb`, the recommended " "method for loading PDB files. This method will be removed in a future release of the OpenFF Toolkit.", MoleculeDeprecationWarning, stacklevel=2, ) toolkit = RDKitToolkitWrapper() return toolkit.from_pdb_and_smiles( file_path, smiles, allow_undefined_stereo, _cls=cls, name=name )
[docs] def canonical_order_atoms(self, toolkit_registry=GLOBAL_TOOLKIT_REGISTRY): """ Produce a copy of the molecule with the atoms reordered canonically. Each toolkit defines its own canonical ordering of atoms. The canonical order may change from toolkit version to toolkit version or between toolkits. .. warning :: This API is experimental and subject to change. Parameters ---------- toolkit_registry openff.toolkit.utils.toolkits.ToolkitWrapper, optional :class:`ToolkitRegistry` or :class:`ToolkitWrapper` to use for SMILES-to-molecule conversion Returns ------- molecule An new OpenFF style molecule with atoms in the canonical order. """ if isinstance(toolkit_registry, ToolkitRegistry): return toolkit_registry.call("canonical_order_atoms", self) elif isinstance(toolkit_registry, ToolkitWrapper): toolkit = toolkit_registry return toolkit.canonical_order_atoms(self) # type: ignore[attr-defined] else: raise InvalidToolkitRegistryError( "Invalid toolkit_registry passed to from_smiles. Expected ToolkitRegistry or ToolkitWrapper. " f"Got {type(toolkit_registry)}." )
[docs] def remap( self, mapping_dict: dict[int, int], current_to_new: bool = True, partial: bool = False, ): """ Reorder the atoms in the molecule according to the given mapping dict. The mapping dict must be a dictionary mapping atom indices to atom indices. Each atom index must be an integer in the half-open interval ``[0, n_atoms)``; ie, it must be a valid index into the ``self.atoms`` list. All atom indices in the molecule must be mapped from and to exactly once unless ``partial=True`` is given, in which case they must be mapped no more than once. Missing (unless ``partial=True``), out-of-range (including non-integer), or duplicate indices are not allowed in the ``mapping_dict`` and will lead to an exception. By default, the mapping dict's keys are the source indices and its values are destination indices, but this can be changed with the ``current_to_new`` argument. The keys of the ``self.properties["atom_map"]`` property are updated for the new ordering. Other values of the properties dictionary are transferred unchanged. .. warning :: This API is experimental and subject to change. Parameters ---------- mapping_dict A dictionary of the mapping between indices. The mapping should be indexed starting from 0 for both the source and destination; note that SMILES atom mapping is typically 1-based. current_to_new If this is ``True``, then ``mapping_dict`` is of the form ``{current_index: new_index}``; otherwise, it is of the form ``{new_index: current_index}``. partial If ``False`` (the default), an exception will be raised if any atom is lacking a destination in the atom map. Note that if this is ``True``, atoms without entries in the mapping dict may be moved in addition to those in the dictionary. Note that partial maps must still be in-range and not include duplicates. Returns ------- new_molecule A copy of the molecule in the new order. Raises ------ RemapIndexError When an out-of-range, duplicate, or missing index is found in the ``mapping_dict``. See Also -------- from_mapped_smiles """ # make sure the size of the mapping matches the current molecule if len(mapping_dict) > self.n_atoms or ( len(mapping_dict) < self.n_atoms and not partial ): raise RemapIndexError( f"The number of mapping indices ({len(mapping_dict)}) does not " + f"match the number of atoms in this molecule ({self.n_atoms})" ) # make two mapping dicts we need new to old for atoms # and old to new for bonds if current_to_new: cur_to_new = mapping_dict new_to_cur = dict(zip(mapping_dict.values(), mapping_dict.keys())) else: new_to_cur = mapping_dict cur_to_new = dict(zip(mapping_dict.values(), mapping_dict.keys())) # Make sure that there were no duplicate indices if len(new_to_cur) != len(cur_to_new): raise RemapIndexError( "There must be no duplicate source or destination indices in" + " mapping_dict" ) if any( not (isinstance(i, int) and 0 <= i < self.n_atoms) for i in [*new_to_cur] + [*cur_to_new] ): raise RemapIndexError( f"All indices in a mapping_dict for a molecule with {self.n_atoms}" + f" atoms must be integers between 0 and {self.n_atoms - 1}" ) # If a partial map is allowed, complete it if partial and len(mapping_dict) < self.n_atoms: # Get a set of all the unspecified destination indices available_indices = {i for i in range(self.n_atoms) if i not in new_to_cur} # Find the atoms that can be left unmoved and don't move them for i in range(self.n_atoms): if i not in cur_to_new and i not in new_to_cur: available_indices.remove(i) cur_to_new[i] = i new_to_cur[i] = i # Fill in the remaining indices for i in range(self.n_atoms): if i not in cur_to_new: j = available_indices.pop() cur_to_new[i] = j new_to_cur[j] = i new_molecule = self.__class__() new_molecule.name = self.name try: # add the atoms list for i in range(self.n_atoms): # get the old atom info old_atom = self._atoms[new_to_cur[i]] new_molecule._add_atom(**old_atom.to_dict()) # this is the first time we access the mapping; catch an index error # here corresponding to mapping that starts from 0 or higher except (KeyError, IndexError): raise RemapIndexError( f"The mapping supplied is missing a destination index for atom {i}" ) # add the bonds but with atom indexes in a sorted ascending order for bond in self._bonds: atoms = sorted([cur_to_new[bond.atom1_index], cur_to_new[bond.atom2_index]]) bond_dict = bond.to_dict() bond_dict["atom1"] = atoms[0] bond_dict["atom2"] = atoms[1] new_molecule._add_bond(**bond_dict) # we can now resort the bonds sorted_bonds = sorted( new_molecule.bonds, key=operator.attrgetter("atom1_index", "atom2_index") ) new_molecule._bonds = sorted_bonds # remap the charges if self.partial_charges is not None: new_charges = np.zeros(self.n_atoms) for i in range(self.n_atoms): new_charges[i] = self.partial_charges[new_to_cur[i]].m_as( unit.elementary_charge ) new_molecule.partial_charges = new_charges * unit.elementary_charge # remap the conformers, there can be more than one if self.conformers is not None: for conformer in self.conformers: new_conformer = np.zeros((self.n_atoms, 3)) for i in range(self.n_atoms): new_conformer[i] = conformer[new_to_cur[i]].m_as(unit.angstrom) new_molecule._add_conformer(new_conformer * unit.angstrom) # move any properties across new_molecule._properties = deepcopy(self._properties) # remap the atom map if "atom_map" in new_molecule.properties and isinstance( new_molecule.properties["atom_map"], dict ): new_molecule.properties["atom_map"] = { cur_to_new.get(k, k): v for k, v in new_molecule.properties["atom_map"].items() } return new_molecule
[docs] def to_openeye( self, toolkit_registry: TKR = GLOBAL_TOOLKIT_REGISTRY, aromaticity_model: str = DEFAULT_AROMATICITY_MODEL, ): """ Create an OpenEye molecule Requires the OpenEye toolkit to be installed. .. todo :: * Use stored conformer positions instead of an argument. * Should the aromaticity model be specified in some other way? Parameters ---------- aromaticity_model The aromaticity model to use. Only OEAroModel_MDL is supported. Returns ------- oemol An OpenEye molecule Examples -------- Create an OpenEye molecule from a Molecule >>> molecule = Molecule.from_smiles('CC') >>> oemol = molecule.to_openeye() """ if isinstance(toolkit_registry, ToolkitWrapper): return toolkit_registry.to_openeye( # type: ignore[attr-defined] self, aromaticity_model=aromaticity_model ) else: return toolkit_registry.call( "to_openeye", self, aromaticity_model=aromaticity_model )
def _construct_angles(self) -> None: """ Get an iterator over all i-j-k angles. """ if not hasattr(self, "_angles"): self._construct_bonded_atoms_list() self._angles = set() for atom1 in self._atoms: for atom2 in self._bonded_atoms[atom1]: for atom3 in self._bonded_atoms[atom2]: if atom1 == atom3: continue if atom1.molecule_atom_index < atom3.molecule_atom_index: self._angles.add((atom1, atom2, atom3)) else: self._angles.add((atom3, atom2, atom1)) def _construct_torsions(self) -> None: """ Construct sets containing the atoms improper and proper torsions Impropers are constructed with the central atom listed second """ if not hasattr(self, "_torsions"): self._construct_bonded_atoms_list() self._propers = set() self._impropers = set() for atom1 in self._atoms: for atom2 in self._bonded_atoms[atom1]: for atom3 in self._bonded_atoms[atom2]: if atom1 == atom3: continue for atom4 in self._bonded_atoms[atom3]: if atom4 == atom2: continue # Exclude i-j-k-i if atom1 == atom4: continue if atom1.molecule_atom_index < atom4.molecule_atom_index: torsion = (atom1, atom2, atom3, atom4) else: torsion = (atom4, atom3, atom2, atom1) self._propers.add(torsion) for atom3i in self._bonded_atoms[atom2]: if atom3i == atom3: continue if atom3i == atom1: continue improper = (atom1, atom2, atom3, atom3i) self._impropers.add(improper) self._torsions = self._propers | self._impropers def _construct_bonded_atoms_list(self) -> None: """ Construct list of all atoms each atom is bonded to. """ # TODO: Add this to cached_properties if not hasattr(self, "_bonded_atoms"): self._bonded_atoms: dict[Atom, set[Atom]] = dict() for atom in self._atoms: self._bonded_atoms[atom] = set() for bond in self._bonds: atom1 = self.atoms[bond.atom1_index] atom2 = self.atoms[bond.atom2_index] self._bonded_atoms[atom1].add(atom2) self._bonded_atoms[atom2].add(atom1) def _is_bonded(self, atom_index_1: int, atom_index_2: int) -> bool: """Return True if atoms are bonded, False if not. Parameters ---------- atom_index_1 atom_index_2 Atom indices Returns ------- is_bonded True if atoms are bonded, False otherwise """ self._construct_bonded_atoms_list() atom1 = self._atoms[atom_index_1] atom2 = self._atoms[atom_index_2] return atom2 in self._bonded_atoms[atom1]
[docs] def get_bond_between(self, i: Union[int, Atom], j: Union[int, Atom]) -> Bond: """Returns the bond between two atoms Parameters ---------- i, j Atoms or atom indices to check Returns ------- bond The bond between i and j. """ if isinstance(i, int) and isinstance(j, int): atom_i = self._atoms[i] atom_j = self._atoms[j] elif isinstance(i, Atom) and isinstance(j, Atom): atom_i = i atom_j = j else: raise TypeError( "Invalid input passed to get_bond_between(). Expected ints or Atoms, " f"got {j} and {j}." ) for bond in atom_i.bonds: for atom in bond.atoms: if atom == atom_i: continue if atom == atom_j: return bond from openff.toolkit.topology import NotBondedError raise NotBondedError(f"No bond between atom {i} and {j}")
[docs]class Molecule(FrozenMolecule): """ Mutable chemical representation of a molecule, such as a small molecule or biopolymer. .. todo :: What other API calls would be useful for supporting biopolymers as small molecules? Perhaps iterating over chains and residues? Examples -------- Create a molecule from an sdf file >>> from openff.toolkit.utils import get_data_file_path >>> sdf_filepath = get_data_file_path('molecules/ethanol.sdf') >>> molecule = Molecule(sdf_filepath) Convert to OpenEye OEMol object >>> oemol = molecule.to_openeye() Create a molecule from an OpenEye molecule >>> molecule = Molecule.from_openeye(oemol) Convert to RDKit Mol object >>> rdmol = molecule.to_rdkit() Create a molecule from an RDKit molecule >>> molecule = Molecule.from_rdkit(rdmol) Create a molecule from IUPAC name (requires the OpenEye toolkit) >>> molecule = Molecule.from_iupac('imatinib') Create a molecule from SMILES >>> molecule = Molecule.from_smiles('Cc1ccccc1') .. warning :: This API is experimental and subject to change. """
[docs] def __init__(self, *args, **kwargs): """ See FrozenMolecule.__init__ .. todo :: * If a filename or file-like object is specified but the file contains more than one molecule, what is the proper behavior? Read just the first molecule, or raise an exception if more than one molecule is found? * Should we also support SMILES strings or IUPAC names for ``other``? """ super(Molecule, self).__init__(*args, **kwargs)
# TODO: Change this to add_atom(Atom) to improve encapsulation and extensibility?
[docs] def add_atom( self, atomic_number: int, formal_charge: int, is_aromatic: bool, stereochemistry: Optional[str] = None, name: Optional[str] = None, metadata: Optional[dict[str, Union[int, str]]] = None, ) -> int: """ Add an atom to the molecule. Parameters ---------- atomic_number Atomic number of the atom formal_charge Formal charge of the atom is_aromatic If ``True``, atom is aromatic; if ``False``, not aromatic stereochemistry Either ``'R'`` or ``'S'`` for specified stereochemistry, or ``None`` if stereochemistry is irrelevant name An optional name for the atom metadata An optional dictionary where keys are strings and values are strings or ints. This is intended to record atom-level information used to inform hierarchy definition and iteration, such as grouping atom by residue and chain. Returns ------- index The index of the atom in the molecule Examples -------- Define a methane molecule >>> molecule = Molecule() >>> molecule.name = 'methane' >>> C = molecule.add_atom(6, 0, False) >>> H1 = molecule.add_atom(1, 0, False) >>> H2 = molecule.add_atom(1, 0, False) >>> H3 = molecule.add_atom(1, 0, False) >>> H4 = molecule.add_atom(1, 0, False) >>> bond_idx = molecule.add_bond(C, H1, 1, False) >>> bond_idx = molecule.add_bond(C, H2, 1, False) >>> bond_idx = molecule.add_bond(C, H3, 1, False) >>> bond_idx = molecule.add_bond(C, H4, 1, False) >>> molecule.to_smiles(explicit_hydrogens=False) 'C' """ atom_index = self._add_atom( atomic_number, formal_charge, is_aromatic, stereochemistry=stereochemistry, name=name, metadata=metadata, ) return atom_index
[docs] def add_bond( self, atom1: Union[int, "Atom"], atom2: Union[int, "Atom"], bond_order: int, is_aromatic: bool, stereochemistry: Optional[str] = None, fractional_bond_order: Optional[float] = None, ) -> int: """ Add a bond between two specified atom indices Parameters ---------- atom1 Index of first atom atom2 Index of second atom bond_order Integral bond order of Kekulized form is_aromatic True if this bond is aromatic, False otherwise stereochemistry Either ``'E'`` or ``'Z'`` for specified stereochemistry, or ``None`` if stereochemistry is irrelevant fractional_bond_order The fractional (eg. Wiberg) bond order Returns ------- index: int Index of the bond in this molecule Examples -------- For an example of use, see :py:meth:`add_atom`. """ bond_index = self._add_bond( atom1, atom2, bond_order, is_aromatic, stereochemistry=stereochemistry, fractional_bond_order=fractional_bond_order, ) return bond_index
[docs] def add_conformer(self, coordinates: Quantity) -> int: """ Add a conformation of the molecule Parameters ---------- coordinates: unit-wrapped np.array with shape (n_atoms, 3) and dimension of distance Coordinates of the new conformer, with the first dimension of the array corresponding to the atom index in the molecule's indexing system. Returns ------- index The index of this conformer """ # TODO how can be check that a set of coords and no connections # is a conformation that does not change connectivity? return self._add_conformer(coordinates)
@overload def visualize( self, backend: Literal["rdkit"], ) -> "IPython.display.SVG": ... @overload def visualize( self, backend: Literal["openeye"], ) -> "IPython.display.Image": ... @overload def visualize( self, backend: Literal["nglview"], ) -> "nglview.NGLWidget": ...
[docs] def visualize( self, backend: str = "rdkit", width: int = 500, height: int = 300, show_all_hydrogens: bool = True, ) -> Union["IPython.display.SVG", "IPython.display.Image", "nglview.NGLWidget"]: """ Render a visualization of the molecule in Jupyter Parameters ---------- backend The visualization engine to use. Choose from: - ``"rdkit"`` - ``"openeye"`` - ``"nglview"`` (requires conformers) width Width of the generated representation (only applicable to ``backend="openeye"`` or ``backend="rdkit"``) height Width of the generated representation (only applicable to ``backend="openeye"`` or ``backend="rdkit"``) show_all_hydrogens Whether to explicitly depict all hydrogen atoms. (only applicable to ``backend="openeye"`` or ``backend="rdkit"``) Returns ------- object Depending on the backend chosen: - rdkit → IPython.display.SVG - openeye → IPython.display.Image - nglview → nglview.NGLWidget """ import inspect from openff.toolkit.utils.toolkits import OPENEYE_AVAILABLE, RDKIT_AVAILABLE backend = backend.lower() if backend == "nglview": try: import nglview as nv except ImportError: raise MissingOptionalDependencyError("nglview") signature = inspect.signature(Molecule.visualize).parameters if (width != signature["width"].default) or ( height != signature["height"].default ): warnings.warn( f"Arguments `width` and `height` are ignored with {backend=}." f"Found non-default values {width=} and {height=}", stacklevel=2, ) if self.conformers is None: raise MissingConformersError( "Visualizing with NGLview requires that the molecule has " f"conformers, found {self.conformers=}" ) else: from openff.toolkit.utils._viz import MoleculeNGLViewTrajectory try: widget = nv.NGLWidget( MoleculeNGLViewTrajectory( molecule=self, ext="MOL2", ) ) except ValueError: widget = nv.NGLWidget( MoleculeNGLViewTrajectory( molecule=self, ext="PDB", ) ) widget.clear_representations() widget.add_representation( "licorice", sele="*" if show_all_hydrogens else "NOT hydrogen", radius=0.25, multipleBond=True, ) return widget if backend == "rdkit": if RDKIT_AVAILABLE: from IPython.display import SVG from rdkit import Chem from rdkit.Chem.Draw import rdDepictor, rdMolDraw2D rdmol = self.to_rdkit() if not show_all_hydrogens: # updateExplicitCount: Keep a record of the hydrogens we remove. # This is used in visualization to distinguish eg radicals from normal species rdmol = Chem.RemoveHs(rdmol, updateExplicitCount=True) rdDepictor.SetPreferCoordGen(True) rdDepictor.Compute2DCoords(rdmol) rdmol = rdMolDraw2D.PrepareMolForDrawing(rdmol) drawer = rdMolDraw2D.MolDraw2DSVG(width, height) drawer.DrawMolecule(rdmol) drawer.FinishDrawing() return SVG(drawer.GetDrawingText()) else: warnings.warn( "RDKit was requested as a visualization backend but " "it was not found to be installed. Falling back to " "trying to use OpenEye for visualization.", stacklevel=2, ) backend = "openeye" if backend == "openeye": if OPENEYE_AVAILABLE: from IPython.display import Image from openeye import oedepict oemol = self.to_openeye() opts = oedepict.OE2DMolDisplayOptions( width, height, oedepict.OEScale_AutoScale ) if show_all_hydrogens: opts.SetHydrogenStyle(oedepict.OEHydrogenStyle_ImplicitAll) oedepict.OEPrepareDepiction(oemol) img = oedepict.OEImage(width, height) display = oedepict.OE2DMolDisplay(oemol, opts) oedepict.OERenderMolecule(img, display) png = oedepict.OEWriteImageToString("png", img) return Image(png) # TODO: More specific exception raise ValueError("Could not find an appropriate backend")
[docs] def perceive_residues( self, substructure_file_path: Optional[str] = None, strict_chirality: bool = True, ): """ Perceive a polymer's residues and permit iterating over them. Perceives residues by matching substructures in the current molecule with a substructure dictionary file, using SMARTS, and assigns residue names and numbers to atom metadata. It then constructs a residue hierarchy scheme to allow iterating over residues. Parameters ---------- substructure_file_path Path to substructure library file in JSON format. Defaults to using built-in substructure file. strict_chirality Whether to use strict chirality symbols (stereomarks) for substructure matchings with SMARTS. """ # Read substructure dictionary file if not substructure_file_path: substructure_file_path = get_data_file_path( "proteins/aa_residues_substructures_with_caps.json" ) with open(substructure_file_path, "r") as subfile: substructure_dictionary = json.load(subfile) # TODO: Think of a better way to deal with no strict chirality case # if ignoring strict chirality, remove/update keys in inner dictionary if not strict_chirality: # make a copy of substructure dict substructure_dictionary_no_chirality = deepcopy(substructure_dictionary) # Update inner key (SMARTS) maintaining its value for res_name, inner_dict in substructure_dictionary.items(): for smarts in inner_dict.keys(): smarts_no_chirality = smarts.replace("@", "") # remove @ in smarts substructure_dictionary_no_chirality[res_name][ smarts_no_chirality ] = substructure_dictionary_no_chirality[res_name].pop( smarts ) # update key # replace with the new substructure dictionary substructure_dictionary = substructure_dictionary_no_chirality all_matches = list() for residue_name, smarts_dict in substructure_dictionary.items(): matches = dict() for smarts in smarts_dict: for match in self.chemical_environment_matches(smarts): matches[match] = smarts all_matches.append( { "atom_idxs": match, "atom_idxs_set": set(match), "smarts": smarts, "residue_name": residue_name, "atom_names": smarts_dict[smarts], } ) # Remove matches that are subsets of other matches # give precedence to the SMARTS defined at the end of the file match_idxs_to_delete = set() for match_idx in range(len(all_matches) - 1, 0, -1): this_match_set = all_matches[match_idx]["atom_idxs_set"] this_match_set_size = len(this_match_set) for match_before_this_idx in range(match_idx): match_before_this_set = all_matches[match_before_this_idx][ "atom_idxs_set" ] match_before_this_set_size = len(match_before_this_set) n_overlapping_atoms = len( this_match_set.intersection(match_before_this_set) ) if n_overlapping_atoms > 0: if match_before_this_set_size < this_match_set_size: match_idxs_to_delete.add(match_before_this_idx) else: match_idxs_to_delete.add(match_idx) match_idxs_to_delete_list = sorted(list(match_idxs_to_delete), reverse=True) for match_idx in match_idxs_to_delete_list: all_matches.pop(match_idx) all_matches.sort(key=lambda x: min(x["atom_idxs"])) # Now the matches have been deduplicated and de-subsetted for residue_num, match_dict in enumerate(all_matches): for smarts_idx, atom_idx in enumerate(match_dict["atom_idxs"]): self.atoms[atom_idx].metadata["residue_name"] = match_dict[ "residue_name" ] self.atoms[atom_idx].metadata["residue_number"] = str(residue_num + 1) self.atoms[atom_idx].metadata["insertion_code"] = " " self.atoms[atom_idx].metadata["atom_name"] = match_dict["atom_names"][ smarts_idx ] # Now add the residue hierarchy scheme self._add_residue_hierarchy_scheme()
def _ipython_display_(self): # pragma: no cover from IPython.display import display try: return display(self.visualize(backend="nglview")) except (ImportError, ValueError): pass try: return display(self.visualize(backend="rdkit")) except ValueError: pass try: return display(self.visualize(backend="openeye")) except ValueError: pass
def _networkx_graph_to_hill_formula(graph: nx.Graph) -> str: """ Convert a NetworkX graph to a Hill formula. Parameters ---------- graph The graph to convert. Returns ------- str The Hill formula corresponding to the graph. """ import networkx as nx if not isinstance(graph, nx.Graph): raise ValueError("The graph must be a NetworkX graph.") atom_nums = list(dict(graph.nodes(data="atomic_number", default=1)).values()) return _atom_nums_to_hill_formula(atom_nums) def _atom_nums_to_hill_formula(atom_nums: list[int]) -> str: """ Given a `Counter` object of atom counts by atomic number, generate the corresponding Hill formula. See https://en.wikipedia.org/wiki/Chemical_formula#Hill_system""" from collections import Counter SYMBOLS_ = deepcopy(SYMBOLS) SYMBOLS_[0] = "X" atom_symbol_counts = Counter(SYMBOLS_[atom_num] for atom_num in atom_nums) formula = [] # Check for C and H first, to make a correct hill formula for el in ["C", "H"]: if el in atom_symbol_counts: count = atom_symbol_counts.pop(el) formula.append(el) if count > 1: formula.append(str(count)) # now get the rest of the elements in alphabetical ordering for el in sorted(atom_symbol_counts.keys()): count = atom_symbol_counts.pop(el) formula.append(el) if count > 1: formula.append(str(count)) return "".join(formula) def _nth_degree_neighbors_from_graphlike( graphlike: MoleculeLike, n_degrees: int, ) -> Generator[ Union[tuple[Atom, Atom], tuple["_SimpleAtom", "_SimpleAtom"]], None, None ]: """ Given a graph-like object, return a tuple of the nth degree neighbors of each atom. The input `graphlike` object must provide a .to_networkx() method and an `atoms` property that can be indexed. See Molecule.nth_degree_neighbors for more details. Parameters ---------- graphlike The graph-like object to get the neighbors of. n: int The number of bonds separating atoms in each pair Returns ------- neighbors tuples (len 2) of atom that are separated by ``n`` bonds. """ graph = graphlike.to_networkx() for node_i in graph.nodes: for node_j in graph.nodes: if node_i == node_j: continue path_length = nx.shortest_path_length(graph, node_i, node_j) if path_length == n_degrees: if node_i > node_j: continue yield (graphlike.atoms[node_i], graphlike.atoms[node_j])
[docs]class HierarchyScheme: """ Perceives hierarchy elements from the metadata of atoms in a ``Molecule``. The Open Force Field Toolkit has no native understanding of hierarchical atom organisation schemes common to other biomolecular software, such as "residues" or "chains" (see :ref:`userguide_hierarchy`). To facilitate iterating over groups of atoms, a ``HierarchyScheme`` can be used to collect atoms into ``HierarchyElements``, groups of atoms that share the same values for certain metadata elements. Metadata elements are stored in the ``Atom.properties`` attribute. Hierarchy schemes are not updated dynamically; if a ``Molecule`` with hierarchy schemes changes, :meth:`Molecule.update_hierarchy_schemes()` must be called before the scheme is iterated over again or else the grouping may be incorrect. A ``HierarchyScheme`` contains the information needed to perceive ``HierarchyElement`` objects from a ``Molecule`` containing atoms with metadata. See also -------- Molecule.add_default_hierarchy_schemes, Molecule.add_hierarchy_scheme, Molecule.hierarchy_schemes, Molecule.delete_hierarchy_scheme, Molecule.update_hierarchy_schemes, Molecule.perceive_residues, Topology.hierarchy_iterator, HierarchyElement """
[docs] def __init__( self, parent: MoleculeLike, uniqueness_criteria: Iterable[str], iterator_name: str, ): """ Create a new hierarchy scheme for iterating over groups of atoms. Parameters ---------- parent The ``Molecule`` to which this scheme belongs. uniqueness_criteria The names of ``Atom`` metadata entries that define this scheme. An atom belongs to a ``HierarchyElement`` only if its metadata has the same values for these criteria as the other atoms in the ``HierarchyElement``. iterator_name The name of the iterator that will be exposed to access the hierarchy elements generated by this scheme """ if (type(uniqueness_criteria) is not list) and ( type(uniqueness_criteria) is not tuple ): raise TypeError( f"'uniqueness_criteria' kwarg must be a list or a tuple of strings," f" received {repr(uniqueness_criteria)} " f"(type {type(uniqueness_criteria)}) instead." ) for criterion in uniqueness_criteria: if type(criterion) is not str: raise TypeError( f"Each item in the 'uniqueness_criteria' kwarg must be a string," f" received {repr(criterion)} " f"(type {type(criterion)}) instead." ) if type(iterator_name) is not str: raise TypeError( f"'iterator_name' kwarg must be a string, received {repr(iterator_name)} " f"(type {type(iterator_name)}) instead." ) self.parent = parent self.uniqueness_criteria = uniqueness_criteria self.iterator_name = iterator_name self.hierarchy_elements: list[HierarchyElement] = list()
[docs] def to_dict(self) -> dict: """ Serialize this object to a basic dict of strings, ints, and floats """ return_dict: dict[str, Union[str, Sequence[Union[str, int, dict]]]] = dict() return_dict["uniqueness_criteria"] = self.uniqueness_criteria return_dict["iterator_name"] = self.iterator_name return_dict["hierarchy_elements"] = [ e.to_dict() for e in self.hierarchy_elements ] return return_dict
[docs] def perceive_hierarchy(self): """ Prepare the parent ``Molecule`` for iteration according to this scheme. Groups the atoms of the parent of this ``HierarchyScheme`` according to their metadata, and creates ``HierarchyElement`` objects suitable for iteration over the parent. Atoms missing the metadata fields in this object's ``uniqueness_criteria`` tuple will have those spots populated with the string ``'None'``. This method overwrites the scheme's ``hierarchy_elements`` attribute in place. Each ``HierarchyElement`` in the scheme's `hierarchy_elements` attribute is `static` --- that is, it is updated only when `perceive_hierarchy()` is called, and `not` on-the-fly when atom metadata is modified. """ from collections import defaultdict self.hierarchy_elements = list() # Determine which atoms should get added to which HierarchyElements hier_eles_to_add: defaultdict[tuple[Union[int, str]], list["Atom"]] = ( defaultdict(list) ) for atom in self.parent.atoms: _atom_key = list() for field_key in self.uniqueness_criteria: if field_key in atom.metadata: _atom_key.append(atom.metadata[field_key]) else: _atom_key.append("None") hier_eles_to_add[tuple(_atom_key)].append(atom) # Create the actual HierarchyElements for atom_key, atoms_to_add in hier_eles_to_add.items(): atom_indices = [p.molecule_atom_index for p in atoms_to_add] self.add_hierarchy_element(identifier=atom_key, atom_indices=atom_indices) self.sort_hierarchy_elements()
[docs] def add_hierarchy_element( self, identifier: tuple[Union[str, int]], atom_indices: Sequence[int], ) -> "HierarchyElement": """ Instantiate a new HierarchyElement belonging to this HierarchyScheme. This is the main way to instantiate new HierarchyElements. Parameters ---------- identifier tuple of metadata values (not keys) that define the uniqueness criteria for this element atom_indices The indices of atoms in ``scheme.parent`` that are in this element """ new_hier_ele = HierarchyElement(self, identifier, atom_indices) self.hierarchy_elements.append(new_hier_ele) return new_hier_ele
[docs] def sort_hierarchy_elements(self): """ Semantically sort the HierarchyElements belonging to this object, according to their identifiers. """ def compare_hier_identifiers(a, b): """A comparison function which can compare hierarchy elements. Expects identifiers to be tuples of string and int. Attempts to cast strings to int. Assumes that ints are "greater than" strings. Returns -1 if a < b, 0 if a==b, and 1 if a>b. See https://docs.python.org/3/howto/sorting.html#comparison-functions """ # Iterate over identifier components for comparison for val1, val2 in zip(a.identifier, b.identifier): # Try converting any strings to ints try: val1 = int(val1) except ValueError: pass try: val2 = int(val2) except ValueError: pass # If val1 and val2 are the same type, use built-in comparison if type(val1) is type(val2): if val1 < val2: return -1 elif val1 > val2: return 1 else: continue # Otherwise, assume that ints are "greater than" strings. else: if type(val1) is int: return 1 elif type(val2) is int: return -1 # If we've finished comparing the values in the identifiers without # finding one to be greater than the other, then these two identifiers # must be equal. return 0 self.hierarchy_elements.sort(key=cmp_to_key(compare_hier_identifiers))
def __str__(self): return ( f"HierarchyScheme with uniqueness_criteria '{self.uniqueness_criteria}', iterator_name " f"'{self.iterator_name}', and {len(self.hierarchy_elements)} elements" ) def __repr__(self): return self.__str__()
[docs]class HierarchyElement: """An element in a metadata hierarchy scheme, such as a residue or chain."""
[docs] def __init__( self, scheme: HierarchyScheme, identifier: tuple[Union[str, int]], atom_indices: Sequence[int], ): """ Create a new hierarchy element. Parameters ---------- scheme The scheme to which this ``HierarchyElement`` belongs identifier tuple of metadata values (not keys) that define the uniqueness criteria for this element atom_indices The indices of particles in ``scheme.parent`` that are in this element """ self.scheme = scheme self.identifier = identifier self.atom_indices = deepcopy(atom_indices) for id_component, uniqueness_component in zip( identifier, scheme.uniqueness_criteria ): setattr(self, uniqueness_component, id_component)
[docs] def to_dict(self) -> dict[str, Union[tuple[Union[str, int]], Sequence[int]]]: """ Serialize this object to a basic dict of strings and lists of ints. """ return { "identifier": self.identifier, "atom_indices": self.atom_indices, }
@property def n_atoms(self) -> int: """ The number of atoms in this hierarchy element. """ return len(self.atom_indices) @property def atoms(self) -> Generator["Atom", None, None]: """ Iterator over the atoms in this hierarchy element. """ for atom_index in self.atom_indices: yield self.parent.atoms[atom_index]
[docs] def atom(self, index: int) -> Atom: """ Get the atom with the specified index. """ return self.parent.atoms[self.atom_indices[index]]
@property def parent(self) -> MoleculeLike: """ The parent molecule for this hierarchy element """ return self.scheme.parent def __str__(self): return ( f"HierarchyElement {self.identifier} of iterator '{self.scheme.iterator_name}' containing " f"{len(self.atom_indices)} atom(s)" ) def __repr__(self): return self.__str__() @property def has_unique_atom_names(self) -> bool: """``True`` if the element has unique atom names, ``False`` otherwise.""" return _has_unique_atom_names(self)
[docs] def generate_unique_atom_names(self): """ Generate unique atom names from the element symbol and count. Names are generated from the elemental symbol and the number of times that element is found in the hierarchy element. The character 'x' is appended to these generated names to reduce the odds that they clash with an atom name or type imported from another source. For example, generated atom names might begin 'C1x', 'H1x', 'O1x', 'C2x', etc. """ return _generate_unique_atom_names(self)
def _has_unique_atom_names( obj: Union[FrozenMolecule, "_SimpleMolecule", HierarchyElement] ) -> bool: """``True`` if the object has unique atom names, ``False`` otherwise.""" unique_atom_names = set([atom.name for atom in obj.atoms]) if len(unique_atom_names) < obj.n_atoms: return False return True def _generate_unique_atom_names(obj: Union[FrozenMolecule, HierarchyElement]): """ Generate unique atom names from the element symbol and count. Names are generated from the elemental symbol and the number of times that element is found in the hierarchy element or molecule. The character 'x' is appended to these generated names to reduce the odds that they clash with an atom name or type imported from another source. For example, generated atom names might begin 'C1x', 'H1x', 'O1x', 'C2x', etc. """ from collections import defaultdict element_counts: DefaultDict[str, int] = defaultdict(int) for atom in obj.atoms: symbol = atom.symbol element_counts[symbol] += 1 # TODO: It may be worth exposing this as a user option, i.e. to avoid multiple ligands # parameterized with OpenFF clashing because they have atom names like O1x, H3x, etc. # i.e. an optional argument could enable a user to `generate_unique_atom_names(blah="y") # to have one ligand be O1y, etc. # https://github.com/openforcefield/openff-toolkit/pull/1096#pullrequestreview-767227391 atom.name = symbol + str(element_counts[symbol]) + "x"